Asanji stands at the edge of the top of a tall building and lobs a watermelon up into the air then proceeds to watch it fall to the street below (luckily it's empty because everybody is at home). The equation below represents the height, off the ground in meters, of the watermelon t seconds after Asanji has thrown it.

h = -4.9t^2 + 9.8t + 28

Approximately, how long does it take the watermelon to hit the ground? Round to the nearest tenth of a second.

The graph of the linear equation, y + 1 = 1/3(x - 3), is given in the attachment below.

A linear equation is an equation of the form "y = mx + b," where x and y are variables, and m is the slope and b is the y-intercept.

To graph a linear equation, of y + 1 = 1/3(x - 3), you can use the following steps:

Rewrite the equation in slope-intercept form to determine its slope (m) and the y-intercept (b).

y + 1 = 1/3(x - 3)

y + 1 = 1/3x - 1

y = 1/3x - 1 - 1

y = 1/3x - 2

The slope (m) of the line would be 1/3, which is the rise over the run of the line.

The y-intercept (b) of the line would be -2, which means the line will intercept the y-axis at -2.

The graph of y + 1 = 1/3(x - 3) is shown in the image below.

Learn more about the linear equation graph on:

https://brainly.com/question/14323743

#SPJ1

Answer:

$4.50

Step-by-step explanation:

Use a proportion:

$6.75 is to 3 bags as x is to 2 bags.

6.75/3 = x/2

3x = 2 × 6.75

x = 4.50

Answer: $4.50

Answer:

  $4.50

Step-by-step explanation:

Given 3 bags of cat food cost $6.75, you want the cost of 2 bags.

Unless there is a volume discount (or surcharge), the price is proportional to the quantity. That means 2 bags will cost 2/3 the amount that 3 bags cost.

  cost of 2 bags = 2/3 · $6.75 = $4.50

Amelia would spend $4.50 on 2 bags of cat food.

Jocelyn buys 41 candies and 25 pretzels by solving system equation using elimination method.

What is a linear equation?

The equations with one, zero, or an infinite number of solutions are known as linear equations with two variables. Each of the two variables in these equations has the largest exponent order of 1. A two-variable linear equation has the conventional form axe + by + c = 0, where x and y are the two variables. The answers can also be expressed as ordered pairs, such as (x, y).

Given that the cost of 1 candy is $4.75 and 1 pretzel is $3.50.

Jocelyn buys 18 candies and pretzels altogether with cost $75.50.

Assume that she buys x candies and y pretzels

Therefore,

x + y = 18  ......(i)

The cost of x candies and y pretzels is 4.75x + 3.50y.

4.75x + 3.50y = 75.50  .....(ii)

Solving equation (i) and (ii) by using elimination method.

Multiply equation (i) by 4.75

4.75x + 4.75y = 85.5 ....(iii)

Subtract equation (ii) from (iii)

4.75x + 4.75y = 85.5

4.75x + 3.50y = 75.50

(-)      (-)             (-)

________________

             1.25 y = 10

                    y  = 8

Putting y = 8 in equation (i)

x + 8 = 18

x = 10

To learn more about system of equations, click on below link:

brainly.com/question/14694091

#SPJ1

The common ratio is 1/5. By dividing each word by the term before it, we may find the geometric progression's common difference.

The common ratio in geometric progression is the ratio of any term in the sequence to divided by the first term.

The Formula to calculate the common ratio in geometric progression, a, ar, ar2, ar3, ar4, ar5… is,

Common ratio = ar/ a = ar2/ ar = ……. = an/ an-1

As stated in the definition, we can compute the common difference of a geometric progression by dividing any term by its preceding term.

Given, the geometric sequence is 625, 125, 25, 5, 1,....

We have to find the common ratio of the given geometric sequence.

In geometric sequence, a, b, c, d, … the common ratio r is given by

r = b/a = c/b = d/c.

So, r = 125/625 = 25/125 = 5/25 = 1/5;

r = 1/5

Therefore, the common ratio is r = 1/5.

To learn more about common ratio refer :

https://brainly.com/question/26509106

#SPJ1

Answer:

B. 25/125

Step-by-step explanation:

Option (b) is correct as mean of top five scorers on soccer team is 8 from given bar graph.

In statistics, in addition to the mode and median, the mean is one of the measures of central tendency. Simply put, the mean is the average of the values in the given set. It indicates that values in a particular data set are distributed equally. The three most frequently employed measures of central tendency are the mean, median, and mode. The total values provided in a datasheet must be added, and the sum must be divided by the total number of values in order to determine the mean. When all of the values are organized in ascending order, the Median is the median value of the given data. While the number in the list that is repeated a maximum of times is the mode.

Mean = (Sum of values)/(Total observations)

Using above formula, we get

Calculating mean for given bar graph,

[tex]=\frac{4+6+10+9+11}{5}\\=\frac{40}{5}\\=8[/tex]

So, mean score of five players comes out to be 8.

Learn more about mean here:

https://brainly.com/question/14532771

#SPJ1

Answer:

6/1.5

Step-by-step explanation:

You said equally, so you need to make sure that each person gets an even share. To do this, you can do people/things. Hence why the answer is 6/1.5!

[tex]6\frac{2}{5} - 4\frac{4}{5}[/tex]  can be solved using subtraction of simple fraction and the final result is 8/5 .

what are simple fraction ?

A fraction in which both the numerator and the denominator consist of whole numbers.

Simplest form of a fraction:

A fraction is said to be in its simplest form if 1 is the only common factor of its numerator and denominator. For example, 8/9 ,because 1 is the only common factor of 8 and 9 in this fraction.

Simplifying proper and improper fraction

We simplify fractions because it is always to work or calculate when the fractions are in the simplest form.

To solve :  [tex]6\frac{2}{5} - 4\frac{4}{5}[/tex]

We know that , in simple fraction  [tex]6\frac{2}{5} - 4\frac{4}{5}[/tex] can be written as ,

[tex]6\frac{2}{5} - 4\frac{4}{5} = \frac{32}{5} - \frac{24}{5} = \frac{8}{5}[/tex]

Hence , 8/5 is the final answer .

Learn more about Simple Fractions at:

https://brainly.com/question/28336721

#SPJ1

The  GCF of each expression that was given above are: 3, 2 , 4 , and 6 which can be written as:

The GCF which isthe “greatest common factor”.  can be  defined as the largest number that is a factor of two or more numbers.

Intance of this is that the GCF of 24 and 36 is 12, and this is due to the fact that the largest factor that is shared by 24 and 36 is 12.

Option 1:

The GCF of 12y-3=3 because the common factor which is the highest factor of 12 and 3 is 3

Option2

The GCF of 4y+10=2  because the common factor which is the highest factor of 4 and 10 is 2 and so on.

Option 3:

The GCF of 28 − 8= 4 because the common factor which is the highest factor of 28 and 8 is 4

Option 4:

The GCF of 30y+18=6 because the common factor which is the highest factor of 30 and 18 is 6

Learn more about GCF at:

https://brainly.com/question/219464

#SPJ1

[tex] \Large{\boxed{\sf Slope = 3}} [/tex]

[tex] \\ [/tex]

The slope of a line passing through two points, also known as its gradient, is calculated using the slope formula.

[tex] \\ [/tex]

[tex] \Large{\left[ \begin{array}{c c c} \underline{\tt Slope \ formula \text{:}} \\~ \\ \tt m = \dfrac{rise}{run} = \dfrac{\Delta y}{\Delta x} = \dfrac{y_2 - y_1}{x_2 - x_1}\end{array} \right] } [/tex]

Where m is the slope of the line.

[tex] \\ [/tex]

First, let's identify our values:

[tex] \sf (\underbrace{\sf 0}_{x_1} \ , \ \overbrace{\sf 0}^{y_1} ) \ \ and \ \ (\underbrace{\sf 4}_{x_2} \ , \ \overbrace{\sf 12}^{y_2} ) [/tex]

[tex] \\ [/tex]

Now, substitute these values into the formula:

[tex] \sf \rightarrow m = \dfrac{12 - 0}{4 - 0} \\ \\ \sf \rightarrow m = \dfrac{12}{4} \\ \\ \\ \rightarrow \boxed{\boxed{\sf m = 3}} [/tex]

[tex] \\ [/tex]

[tex] \hrulefill [/tex]

[tex] \\ [/tex]

▪️Learn more about the slope formula here:

↣https://brainly.com/question/28293929

Answer:

slope = 3

How to Solve:

The question is asking us to find the slope, given two points.

These points are (0,0) and (4,12).

We will use the slope formula:

[tex]\boldsymbol{m=\dfrac{y_2-y_1}{x_2-x_1}}[/tex]

Where:

Plug in the data:

[tex]\boldsymbol{m=\dfrac{12-0}{4-0}}[/tex]

[tex]\boldsymbol{m=\dfrac{12}{4}}[/tex]

Simplify the fraction to its lowest terms:

[tex]\boldsymbol{m=3}[/tex]

Therefore, the slope is 3.

Answer:

351.5625

1,440,000

Step-by-step explanation:

[tex]\boxed{\begin{minipage}{7 cm}\underline{General form of an Exponential Function}\\\\$y=Ae^{kt}$\\\\where:\\\phantom{ww}$\bullet$ $A$ is the initial value ($y$-intercept). \\ \phantom{ww}$\bullet$ $k$ is a constant.\\ \phantom{ww}$\bullet$ $t$ is time.\\\end{minipage}}[/tex]

Given:

(Let t = time in minutes).

If the doubling period is 15 minutes, then at t = 135 minutes, y = 180,000:

[tex]\implies 90000=Ae^{120k}[/tex]

[tex]\implies 180000=Ae^{135k}[/tex]

Divide the second equation by the first to eliminate A, and solve for k:

[tex]\implies \dfrac{180000}{90000}=\dfrac{Ae^{135k}}{Ae^{120k}}[/tex]

[tex]\implies 2=\dfrac{e^{135k}}{e^{120k}}[/tex]

[tex]\implies 2=e^{135k} \cdot e^{-120k}[/tex]

[tex]\implies 2=e^{15k}[/tex]

[tex]\implies \ln 2 = \ln e^{15k}[/tex]

[tex]\implies \ln 2 =15k \ln e[/tex]

[tex]\implies \ln 2 =15k[/tex]

[tex]\implies k=\dfrac{1}{15}\ln 2[/tex]

Substitute t = 120, y = 90000 and the found value of k into the formula and solve for A:

[tex]\implies 90000=Ae^{\left(120 \cdot \frac{1}{15}\ln 2\right)}[/tex]

[tex]\implies 90000=Ae^{\left(8\ln 2\right)}[/tex]

[tex]\implies 90000=Ae^{\ln256}[/tex]

[tex]\implies 90000=256A[/tex]

[tex]\implies A=\dfrac{90000}{256}[/tex]

[tex]\implies A=351.5625[/tex]

Therefore, the function that models the scenario is:

[tex]\large\boxed{y=351.5625e^{\left(\frac{1}{15}t \ln 2\right)}}[/tex]

So the initial population at time t = 0 was:

To find the size of the bacteria population after 3 hours, substitute t = 180 into the found formula:

[tex]\implies y=351.5625e^{\left(\frac{1}{15}(180) \ln 2\right)}[/tex]

[tex]\implies y=351.5625e^{\left(12 \ln 2\right)}[/tex]

[tex]\implies y=351.5625e^{\left(\ln 4096\right)}[/tex]

[tex]\implies y=351.5625 \cdot 4096[/tex]

[tex]\implies y=1440000[/tex]

Therefore, the size of the bacterial population after 3 hours was:

The initial population at the time t = 0 is 351.5625. And the size of the bacterial population after 3 hours is 1,440,000.

An exponential function's curve is created by a pattern of data called exponential growth, which exhibits higher increases over time.

If n₀ is the initial size of a population experiencing exponential growth, then the population n(t) at time t is modeled by the function:

n(t) = n₀(e[tex])^{rt}[/tex]

Where r is the relative rate of growth expressed as a fraction of the population.

Given:

Doubling period = 15 minutes

At t = 120 minutes, n(t) = 90,000

If the doubling period is 15 minutes, then at t = 120+15 = 135 minutes,

90000 = n₀(e[tex])^{120r}[/tex]

18000 =  n₀(e[tex])^{135r}[/tex]]

To find the r:

Take ratio of both of the equations,

90000 / 18000 = n₀(e[tex])^{120r}[/tex]  /   n₀(e[tex])^{135r}[/tex]

2 = (e[tex])^{135r}[/tex] . (e[tex])^{-120r}[/tex]

r = 1/15 ln2

Substitute the value of r, t and y.

90000 = n₀(e[tex])^{120r}[/tex]

90000 = 256n₀

n₀ = 351.5652

Now, the function

n(t) = n₀(e[tex])^{rt}[/tex]

n(t) = (351.5652)(e[tex])^{(1/15)(180)(ln2)}[/tex]

n(t) = 1440000

Therefore, the initial population at the time t = 0 is 351.5625. And the size of the bacterial population after 3 hours is 1,440,000.

To learn more about the exponential growth;

https://brainly.com/question/12490064

#SPJ1

Answer:

5

Step-by-step explanation:

The slope or gradient of the line

using this formula as our guide line

y = mx +b

where m = slope

x = x– intercept

b = y– intercept

so

y = 5x + 12

the slope will be 5

i hope i helped pls rate as brainliest

The length of string in feet she will need for her patio is equal to : L{s} = 2(x + y).

Given is Camilla who wants to attach a string of lights to the edges of her patio for a party. She does not want the string to go across the edge with the steps.

Assume the shape of the patio is a rectangle with the dimensions of [x] and [y] units long. The length of string in feet she will need will be equivalent to the perimeter of the rectangle. So, the length of string in feet she will need is equal to L{s} = 2(x + y).

Therefore, the length of string in feet she will need for her patio is equal to : L{s} = 2(x + y).

To solve more questions on functions, expressions and polynomials, visit the link below -

brainly.com/question/17421223

#SPJ1

Answer:

5x+48=130

Step-by-step explanation:

5 is the money she gets each week. X is the number of weeks. X can be found easily but for the sake of this question, It's unknown. so 5x and then add the 48 she's already saved you get 5x+48=130 or 5x+48 is greater than or equal to 130.

Answer:

She Does NOT

Step-by-step explanation:

3/4 is .75 1 1/3 is 1.33 3/4*2= 1.5 which is more than 1.33

If x = 2, y = 6, and z = 4, which expression is equivalent to 4? à 54+0-3+2=4. D Xtra 4 ... A tree is 12 feet tall and casts a shadow 9 feet long. A building nearby.

Given that they are age 55 or older, it is discovered that there is a (E) 0.8181 = 81.81% probability that the person said no.

Simply put, probability refers to the likelihood that something will occur.

If we don't know how an event will turn out, one can discuss the probability or likelihood of several events.

Statistics is the study of occurrences that match a probability distribution.

So, as 36 out of 44 adults aged 55 or older chose not to answer the question, the probability is given by:

p = 36/44 = 0.8181

Therefore, given that they are age 55 or older, it is discovered that there is a (E) 0.8181 = 81.81% probability that the person said no.

Know more about probability here:

https://brainly.com/question/28924396

#SPJ4

The altitude of the balloon now is 324 meters

From the question, we have the following parameters that can be used in our computation:

Initial altitude = 288 meters

Rise = 36 meters

The altitude of the balloon now is calculated as

Current altitude = Initial altitude + Rise in altitude

Substitute the known values in the above equation, so, we have the following representation

Current altitude = 288 + 36

Evaluate the sum

Current altitude = 324

Hence, the current altitude is 324 meters

Read more about addition at

https://brainly.com/question/4721701

#SPJ1

The cotangent of the angle is -√570/30

From the question, we have the following parameters that can be used in our computation:

(√30/7,-√19/7)

This means that

(x, y) = (√30/7,-√19/7)

The cot(θ) is calculated as

cot(θ) = y/x

Substitute the known values in the above equation, so, we have the following representation

cot(θ) = (-√19/7)/(√30/7)

Evaluate

cot(θ) = -√19/√30

Rationalize

cot(θ) = -√570/30

Hence, the value of cot(θ) is -√570/30

Read more about unit circle at

https://brainly.com/question/20691579

#SPJ1

Thus ,  it  is False. As there is confidence level is not given, then cant calculate the sample size.

The standard deviation in statistics is a measure of how widely spread a set of values can be or how much they can vary. A low standard deviation denotes that values are typically close to the mean of the collection, whereas a high standard deviation indicates that values are dispersed across a greater range.

Here,

The standard error of the sample mean is equal to 2 for samples of size n if all conceivable samples of that size are taken from a population with an infinite mean and standard deviation.

In the above statement confidence level is not given.

Thus ,  it  is False. As there is confidence level is not given, then cant calculate the sample size.

To know more about standard deviation , visit

https://brainly.com/question/23907081

#SPJ4

By using properties of triangle, it can be calculated that-

The pilot is 2740 miles from her starting position.

What is a triangle?

A triangle is a three sided two dimensional figure. A triangle has three sides and three interior angles.

Here,

The diagram has been attached

Time = 130 minutes = 2 hrs 10 minutes = [tex]2 + \frac{10}{60}[/tex] hours = [tex]\frac{13}{6}[/tex] hours

Speed = 600 miles per hour

Distance = [tex]\frac{13}{6} \times 600[/tex] = 1300 miles

Now,

Time = 145 minutes = 2 hrs 25 minutes = [tex]2 + \frac{25}{60}[/tex] hours = [tex]\frac{29}{12}[/tex] hours

Distance = [tex]\frac{29}{12}\times 600[/tex] = 1450 miles

Angle = [tex]10^{\circ}[/tex]

[tex]c^2 = 1300^2 + 1450^2 - 2\times 1300\times 1450\times cos(180-10)\\c^2 = 1690000 + 2102500 - (-3712725.2)\\c^2= 7505225.2\\c= \sqrt{7505225.2}\\c = 2740[/tex]

The pilot is 2740 miles from her starting position.

To learn more about triangle, refer to the link-

https://brainly.com/question/17335144

#SPJ1

Answer:

Step-by-step explanation:

To solve this problem, we need to add and subtract the fractions given. To do this, we need to find a common denominator for all of the fractions.

The least common multiple of 4, 16, and 12 is 48, so we can rewrite each fraction with a denominator of 48:

1/4 = 3/12

29/16 = 87/48

9735/12 = 4047/48

Then, we can add and subtract the fractions as follows:

3/12 + 87/48 - 4047/48 = (3 - 4047)/48 = -4044/48 = -84/16

Therefore, the final answer is -84/16, or -5 and 1/16 in simplified form.

The answers for the following trigonometric functions are:

a) Sin(A)=√15/4

b) Cos(A)=1/4

c) Cos(A+B)=(√3-√15)/8

Cos (A- B)=(√3+15)/8

d) Sin(A+ B) =(3√5+1)/8

Sin (A- B)==(3√5-1)/8

e) The quadrant of A+B and A-B is 4th quadrant

f)  Sin(2A + 2B)= (√15-6√5+4√3)/8

The trigonometric functions in mathematics are real functions that link the angle of a right-angled triangle to the ratios of two side lengths. They are also known as circular functions, angle functions, or goniometric functions. They are widely employed in all fields of geometry-related study, including geodesy, solid mechanics, celestial mechanics, and many more. Because they are some of the most basic periodic functions, Fourier analysis is frequently employed to examine periodic events.

The sine, cosine, and tangent are the trigonometric functions that are most frequently utilized in contemporary mathematics.

Given,

Cos(A) = 1/4 and Sin(B) = 1/2

4=√1+x²

1+x²=16

x²=15

x=√15

4=1+x²

x²=3

x=√3

a) Sin(A)=√15/4

Sin(B)=1/2

b) Cos(A)=1/4

Cos(B)=√3/2

c) Cos(A+B)=CosACosB-SinASinB

=(1/4)(1/2)-(√15/4)(1/2)

=(√3-√15)/8

Cos(A-B)=CosACosB+SinASinB

=(1/4)(√3/2)+(√15/4)(1/2)

=(√3+15)/8

d) Sin(A+B)+SinACosB+CosASinB

=(√15/4)(√3/2)+(1/4)(1/2)

=(3√5+1)/8

Sin(A-B)=SinACosB-SinBCosA

=(√15/4)(√3/2)-(1/4)(1/2)

=(3√5-1)/8

e) The quadrant of A+B and A -B is 4th quadrant.

f) Sin(2A+2B)=Sin2ACos2B+Cos2ASin2B

=(√15/8)(1-√3)+((4-√15)/4)(√3/2)

=(√15-3√5+4√3-3√5)/8

=(√15-6√5+4√3)/8

To know more about trigonometric functions, visit:

https://brainly.com/question/14746686

#SPJ1

Answer:

y = 5

Step-by-step explanation:

The motion of the object on the graph, can best be represented as an object that d. was at rest and is accelerating uniformly.

The object on the graph is accelerating such that the acceleration is stable and uniform. This is why the speed - time line is a straight and diagonal line to show that the speed is proportional to time.

We know that the object started from rest because at the point where time was 0, the object was not accelerating and so was not moving. As time moves on, the object increases speed, thereby accelerating.

Find out more on acceleration at https://brainly.com/question/24606066

#SPJ1

The given equations can be simplified as :

a. -2.√15

b.  c ≥ 0

c.   x = ±2√6

d.   y < 0

e.   a > 0

How to solve inequalities ?

When solving an inequality:

a.

Given : √(3-√15)²-√(3+√15)²

   √(3-√15)²-√(3+√15)² = (3-√15)-(3+√15)

   √(3-√15)²-√(3+√15)² = 0 -2√15

   √(3-√15)²-√(3+√15)² = -2.√15

b .  

Given : 3√c² if c≥0

     3√c² if c≥0

    c ≥ 0

c.

Given: √(x²+1)²=5

     √(x²+1)²=5

      on Squaring both sides , we get

      (x²+1) = 25

      x²  = 24

      x = ±2√6

d.

Given : -5√y² if y>0

      -5√y² if y>0

       y < 0 [since , -5 < 0]

e.  

Given : 0.5√16a² if a<0

     0.5√16a² if a<0

      a > 0

Learn more inequalities at :

https://brainly.com/question/24372553

#SPJ1

Thus after 12 minutes concentration of drug is 0.045.

The concentration C(t) of a certain drug in the bloodstream after t minutes is given by the formula [tex]c(t) = 0.05(1-e^{-0.2t} )[/tex]

Drug concentration is amongst the most important determinants of clinical response to a drug.

Drug concentration will be seen to increase in biological samples drawn from the systemic circulation when the amount of drug absorbed exceeds the amount of drug that is distributed into the extravascular tissues and the drug that is metabolized and/or excreted during this period.

Thus after 12 minutes concentration of the drug is = C(5).

Now

C(5) = [tex]0.05(1-e^{-0.2t} )[/tex]

= [tex]0.05(1-e^{-2.4} )[/tex]

= 0.05(1-0.0907)

= 0.05×0.9093

= 0.045

The drug concentration is 0.045.

For such more questions about concentration:

https://brainly.com/question/14378082

#SPJ4

Answer:

x=6

Step-by-step explanation:

9-3=6 or 6+3=9

Answer:

415 miles

Step-by-step explanation:

Start with the speed equation:

speed = distance/time

Now solve the speed equation for distance:

distance = speed × time

Apply the speed equation solved for distance to the two parts of the trip.

4 hours at 55 mph:

distance = 55 mph × 4 hours = 220 miles

3 hours at 65 mph:

distance = 65 mph × 3 hours = 195 miles

Add the two distances to find the total distance:

total distance = 220 miles + 195 miles = 415 miles

Answer: 415 miles

Answer:

415 miles

Step-by-step explanation:

Simon drove 55 miles per hour for 4 hours then 65 miles per hour for 3 hours.

How far did he drive?

d=rt

For the first part of the trip:

d = 55 * 4 = 220 miles

For the second part of the trip:

d = 65*3 =195 miles

Add the miles together

220+195 = 415 miles

The derivative of the function is not defined overall on the interval [1, 5]

       [tex]F(x)=\int_{a}^{x}\frac{t +1}{t - 1} dt\\\\F^{'}(x) = \frac{x+1}{x-1}[/tex]

To learn more about calculus, refer:

https://brainly.com/question/11237537

#SPJ4