carbon and tin are both in the fourth column of the table which would you expect to have the greater electronegativity

Answers

Answer 1

Answer: Carbon

Explanation:

electronegativity decreases when you go down a column

Answer 2

The study of chemical bonds is called chemistry.

The correct answer is carbon.

The more negative charge present on an atom shows the electronegativity.

The attraction of the nucleus to the proton is also referred to as electronegativity.

The smaller the radius more the electronegativity.

Hence, the correct answer is Carbon as it has fewer atoms and a smaller radius.

For more information, refer to the link:-

https://brainly.com/question/12985618


Related Questions

Match these solutions with their examples:
Liquid in liquid
Solid in liquid
gas in liquid
gas in gas
solid in solid
liquid in solid
Gas in solid

Examples
A. Air
B. seawater
C. marshmallow

Answers

Answer:

sea water

Explanation:

a sea water can match the following

Why is our mindset more important when you try to learn remotely than when you are learning face to face?

Answers

Answer:

It is more important because of the freedom.

Explanation:

While at home you can do your work of course... but you could lay down, take a nap. You could get on the game, play around. You could draw, and fiddle and dance and do WHATEVER you want with no teacher to stop you so you have to be your own motivation. You have to be your own teacher or its VERY easy to fail.

Explain why both a power source (like a battery) and a complete circuit are necessary for an electromagnet to function. 

 
this is science homework by the way, please help me with it:)​

Answers

Answer:

Electromagnets are only functional when electricity is passing through them. In other words, they only create a magnetic field when there is an electric current flowing.

A power source like a battery is therefore necessary to supply the electric current necessary for the magnet to work however, it will not work unless the circuit is closed as electricity cannot not flow in an open circuit because current needs to be able to flow from one end of a power source to the other end.

Explanation:

ha hot dog hamburger hamburger ng baboy hahaha bomba girl home baboy

Analysis of a sample of an oxide of nitrogen gave 47% of nitrogen.What is the empirical formula of the oxide?

Answers

Answer:

N2O

Explanation:

hope am right.....

Determine which equations you would use to solve the following problem: Calculate the amount of heat needed to change 20.0 g of ice at -10.0°C to water at 89.0°C.

Answers

Answer:

Q = 4019.4 J

Explanation:

Given data:

Mass of ice = 20.0 g

Initial temperature = -10°C

Final temperature = 89.0°C

Amount of heat required = ?

Solution:

specific heat capacity of ice is 2.03 J/g.°C

Formula:

Q = m.c. ΔT

Q = amount of heat absorbed or released

m = mass of given substance

c = specific heat capacity of substance

ΔT = change in temperature

ΔT = T2 - T1

ΔT =  89.0°C - (-10°C)

ΔT = 99°C

Q = 20.0 g ×2.03 J/g.°C × 99°C

Q = 4019.4 J

How many Joules of heat are needed to melt 3.0 g of ice?

Answers

Answer:A substance must absorb heat energy so that it can melt or boil. The temperature of the substance does not change during melting, boiling or freezing - even though energy is still being transferred

Explanation:imm not sure

How do scientist respond to experimental observations that don’t match current theories?

Answers

Answer: The results of the experimental observations should coincide with the facts of the current theories.

Explanation:

The scientific theory can be defined as the well defined as supported explanation for a natural phenomena. It is based upon the facts observed and also supported by the evidences obtained from the experimental trials.

If the experimental observations do not match with the concept of current scientific theory then the scientific either perform the experiment with the same scientific methodology or can switch to another scientific methodology to satisfy the facts of the current theories.

Please help me with my Chemistry homework!! I have so much homework to do for other classes and I’m so stressed so even answering one question would be amazing!!!

1. A graduated cylinder had an initial volume of water of 22 mL. After an iron nail is dropped into the cylinder, the water rises to 38 mL. What is the volume of the nail?

2. Ms.Chavez dropped a gold ring into a graduated cylinder filled with water. The water level was originally at 20 mL. Now the water is at 25mL. Ms.Chavez knows that means the volume of the ring is 5 mL. What else would she have to do to find the density of her ring? Explain.

3. A simple of liquid propanol has a volume of 20.0 cm*^3 and a mass of 15.0 g. What is the density of propanol? Write only your answer below.

Answers

1. 16 mL

2. She need to find the mass, as density is mass divided by volume.

3. 0.75 g/cm^3

What is the mass of one electron in grams if an electron has the charge of
-1.6022 x 10-19C and lg = -1.76 x 108 C.

Answers

The mass of one electron : 9.103 x 10⁻²⁸ g

Further explanation

Electrons are a part of the atomic nucleus particles (including protons and neutrons), and are negatively charged (-1)

An electron has the charge of  -1.6022 x 10⁻¹⁹C

1 g =  -1.76 x 10⁸ C

so the mass of one electron :

[tex]\tt \dfrac{1.6022\times 10^{-19}}{1.76\times 10^8}=9.103\times 10^{-28}~g[/tex]

OK HURRY AND PLEASE ANSWER COZ THIS TEST IS TIMED BROS

What is the sum of the coefficients in the balanced chemical equation for the combustion of acetone, C3H6O(l), in air?
Express answer as an integer

Answers

Answer:

C3H6O + 4O2 → 3CO2 + 3H2O or 11

Explanation:

Answer:

11

Explanation:

The average speeds of gas molecules in cylinders A, B, C, and D are 0.001 m/s, 0.05 m/s, 0.1 m/s, and 0.5 m/s respectively. Which cylinder contains gas that is closest to absolute zero?​

Answers

Answer:

cylindar a

Explanation:

I took the test

Answer:

A

Explanation:

Which container has gas stored at the highest temperature

Answers

Answer: 3

Explanation:

Answer:

kinetic energy

Explanation:

may be iam not sure

A balloon filled with helium floats in the air. What does this tell you about the density of helium?

Answers

Answer:

helium is denser than air

Answer:

For air, which has a molar mass of 29.0 g/mol, this gives a density of 1.18 g/l. Helium, which has a mass of 4.00 g/mol, has a density of 0.164 g/l.

Use the equation below to solve the problem that follows.

2H2 (g) + O2 (g) → 2H2O (g)

When David reacts 13.8 grams of hydrogen gas with excess oxygen, 87.0 grams of water are formed. Calculate his percent yield of water.

Answers

Percent yield = 70%

Further eplanation

Percent yield is the comparison of the amount of product obtained from a reaction with the amount you calculated

General formula:

Percent yield = (Actual yield / theoretical yield )x 100%

An actual yield is the amount of product actually produced by the reaction. A theoretical yield is the amount of product that you calculate from the reaction equation according to the product and reactant coefficients

Reaction

2H₂ (g) + O₂ (g) → 2H₂O (g)

mass of H₂O (theoretical) :

[tex]\tt mass=mol\times MW(mol~ratio~H_2O\div H_2=2\div 2)\\\\mass=(\dfrac{2}{2}\times \dfrac{13.8}{2})\times 18~g/mol\\\\mass=124.2~g[/tex]

percent yield

[tex]\tt \%yield=\dfrac{87}{124.2}\times 100\%=\boxed{\bold{70\%}}[/tex]

Arrange the elements in order of increasing ionization energy. Use the
periodic table to identify their positions on the table.
Drag each tile to the correct box.
Hola
Tiles
chlorine
fluorine
gallium
phosphorus
Sequence

Answers

Answer:

Gallium - Phosphorous - Fluorine - Chlorine

Explanation:

Answer:

Gallium < Phosphorus < Chlorine < Fluorine

Explanation:

<3

PLZ ANSWER! MULTIPLE CHOICE!! MUST BE CORRECT!! I CANNOT GET THIS WRONG.

Answers

The answer is B, the second choice

How many molecules of CO2 are contained in 4.40g of CO2

Answers

Answer:

6.02 x 10²²molecules

Explanation:

Given parameters:

Mass of CO₂  = 4.4g

Unknown:

Number of molecules in CO₂  = ?

Solution:

To find the number of molecules in the given mass, we have to find the number of moles in the compound first;

   Number of moles  = [tex]\frac{mass}{molar mass}[/tex]  

Molar mass of CO₂  = 12 + 2(16) = 44g/mol

Insert the parameters and solve;

   Number of moles  = [tex]\frac{4.4g}{44g/mol}[/tex]   =  0.1mol

  1 mole of a substance contains 6.02 x 10²³molecules

  0.1 mole of CO₂ will contain 0.1 x 6.02 x 10²³molecules

                                                 = 6.02 x 10²²molecules

HELPP ME

express with equations the transformations marked on the scheme

Answers

Further explanation

The reaction equation is the chemical formula of reagents and product substances

A reaction coefficient is a number in the chemical formula of a substance involved in the reaction equation. The reaction coefficient is useful for equalizing reagents and products.

Transformations :

1. CaO + H₂O⇒Ca(OH)₂

2. CaO + CO₂⇒CaCO₃

3. Ca(OH)₂+ 2HCl⇒CaCl₂+2H₂O

4. Ca(OH)₂+H₂CO₃⇒CaCO₃+2H₂O

5. CaCO₃⇒CaO+CO₂

An oxide named CrO. So the salt of chromium has the corresponding valence​

Answers

Answer:

this question doesnt make any sene

Explanation:

An unbalanced chemical equation is shown:

2NaN3 → 2Na + N2

Which of the following statements explains why the equation is not balanced?

Four molecules of N2 should be produced during the decomposition.
Three molecules of N2 should be produced during the decomposition.
Four molecules of N2 should be produced during the synthesis reaction.
Three molecules of N2 should be produced during the synthesis reaction.

Answers

The correct statement is B. Three molecules of N₂ should be produced during the decomposition. :)

Answer: b

Explanation: I took the quiz

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

What is 13.48cm+7.6cm rounded to the correct number of significant figures?

Answers

The lowest amount of significant figures has to be what the answer is...

7.6cm is 2 sig figs where 13.48 is 4, so the answer can only really be as precise as the smallest one (7.6)

7.6 + 13.48 = 21.08cm

Put it into 2 sig figs makes it
=21 cm (2s.f) <— don’t forget to write 2 sig figs next to it because otherwise it is a false answer

Calculate the gravitational force between two objects when they are 0.75m apart each object has a mass of 5.00kg

Answers

Answer:

0.000000000666863

Explanation:

F = GMm/R²

BEST ANSWER WILL BE MARKED BRAINIEST
Why does photosynthesis occur? Please explain your answer and do NOT google to find the answer.

Answers

Answer:

photosynthesis occurs so the plants can create energy from carbon dioxide and sunlight.  

Explanation:

so basiclly it occurs so the plants can create energy to stay alive.

Answer:

Explanation:

photosynthesis occurs basically to help plants get light in order to produce its necessary daily production of nutrients needed for animals to get carbohydrates froms which is eaten by animals since it gives energy. so basically photosynthesis--> energy --> carbs for mammals to eat!

the green colour reflects off the plant so it is not absorbed by the chloroplasts  rather all colours are absorbed just not green.

and every organic material on earth is produced by these cells which convert energy from the sun into nutrient filled plants.. its essential for the CO2 cycle ,  and since they conduct photo synthesis they are lowest level in the food chain so basically its important since they create nutrients for our plants.

if you had a chance to get a scholarship abroad?what would you do?​

Answers

Answer:

I Would bc it's the better opportunity

SECOND SCIENCE WORKSHEET:
Answer the following:
1:
Which type of cell has a cell wall?
2: What is the smallest part of any substance?
3:
What is used to see tiny objects?
4: What name is given to a substance where all the atoms are the
same?
5: What does the safety symbol with flames mean?
6: What gives the ability to do work?
7: Which part of the cell controls all cell activity?
8: By what process does a liquid change to a gas?
I

Answers

Answer:

1 animal cell

2?

3 mircoscope

4?

5 it means whenever you becareful

The diagram is a model of one way that materials move into a cell.


Which Sentence explains what happens in last step?

A. a vacuole carries particles into the cell
B. The cell membrane surrounds particles outside the cell.
C. Phospholipids in the cell membrane allow particles to pass through
D. Transport proteins push particles out of cell.

Answers

Answer:

B. The cell membrane surrounds particles outside the cell.

Explanation:

The last step is when the cell membrane completely surrounds particles outside the cell.

This process is often known as endocytosis.

endocytosis is the process whereby a cell ingests materials by engulfing them using the cell membrane. In this process, the cell membrane completely covers the food.

What is the pressure inside a 2.0 L bottle filled with 0.25 mol of carbon dioxide gas at 25 °C?

Answers

Answer:

3.1atm

Explanation:

Given parameters:

Volume of gas = 2L

Number of moles  = 0.25mol

Temperature  = 25°C = 25 + 273  = 298K

Unknown:

Pressure of the gas = ?

Solution:

To solve this problem, we use the ideal gas equation.

This is given as;

       PV  = nRT

P is the pressure

V is the volume

n is the number of moles

R is the gas  constant  = 0.082atmdm³mol⁻¹K⁻¹

T is the temperature

          P  = [tex]\frac{nRT}{V}[/tex]  

 Now insert the parameters and solve;

         P  = [tex]\frac{0.25 x 0.082 x 298}{2}[/tex]   = 3.1atm

The theory of plate tectonics was, at first, rejected by most scientists. Now most geologists accept that tectonic plates exist and that these tectonic plates can and do move. What is responsible for the change in how scientists think about plate tectonics?

Answers

Answer:

The validation of seafloor spreading in the 1950s and 60s

Explanation:

The theory of seafloor spreading was supported by numerous evidence including thermal probes that showed that heat flow over the mid-ocean ridges measured up to four times those measured in general bottom sediments, which are taken as due to the presence of molten Earth material close to the ridge crest

The ridge crest also show signs unusually seismic wave velocities that are considered to be due to microfracturing and thermal expansion from upwelling magma

What is filtration .
Will mark as brainliest

Answers

Answer:

the action or process of filtering something or in chemistry separating suspended solid matter from a liquid causing latter to pass through the pores is some substance

It is the action or process of filtering something.
Other Questions
what is the equation of the line that passes through the points (2, 7) and is parallel to the line y= 4x+3 Which of these expressions is the simplified form of the expression (Sin(x)/1-cos^2(x)) tan(x/2)?Edge 2020 PLEASE HELP ME!!! DON"T ANSWER IT IF YOU DON"T KNOW!!!Which statement describes Hutton and Lyells work?A) Both Hutton and Lyell studied fossils and realized that fossils of extinct animals resemble some modern animals.B) Both Hutton and Lyell claimed that Earth was very old and changed very slowly over time.C) Both Hutton and Lyell hypothesized that an organism's traits changed based on what the organism did or needed. The improved trait was then passed on to its offspring.D) Both Hutton and Lyell claimed that human population grew over time and was checked by factors such as war, plague, or famine. what's the answer? 4/51/3? Write the equation of the line in slope intercept form given:m = -6, b = 0 Which number lines have points that represent additive inverses? Check all that apply. (-11,9), (5,0)Find the slope of the line through each pair of points Essay on children day PLEASE HELP!!! Lionel works for an energy company interested in drilling for oil off the coast of a small island. The representative for the local fishing industry, Rochelle, says that locals are vigorously opposed to Lionels idea. A town meeting is held. Lionel explains how his company is dedicated to practicing the safest drilling techniques. He explains that oil piped from the oceans floor is purer and that it can be harvested in a more efficient way than an oil rig on land. Lionel also emphasizes how much the trucks carrying fish to the markets all over the country would save if local oil was able to be used. Rochelle fires back that in the past, serious accidents with offshore oil drilling have been reported. She points out that if there were a spill, the resulting death of fish would cost the local fisherman their livelihood. Local opinion on the issue is split. Before the town agrees to side with Lionels energy company or Rochelles local fish industry, officials orde Allen finds himself addicted to an illegal drug. Though he considers his crime harmless, his offense is considered a crime against ____________. What is the common difference between successive terms in the sequence? 0.36, 0.26, 0.16, 0.06, 0.04, 0.14 If a plant takes in 6 CO2 molecules and 6 H2O molecules in order to build one C6H12O6 molecule, what element will the plant have "extra" of / What element will be "extra"? Y=8-x 7=2-y Substitute to solve I will give Brainliest for the correct answer Hurry please!! Il signor Rossi percepisce uno stipendio mensile di2000 euro. Lazienda dove lavora, in seguito a un periodi di utili superiori al previsto, aumenta gli stipendi del 6%.Successivamente, a causa di un periodo di crisi, gli stipendi vengono diminuiti del 6%. Dopo laumento e la diminuzione, a quanto ammonter lo stipendio del signor Rossi? E qual e in percentuale la variazione di stipendio rispetto allo stipendio iniziale?RISPOSTA: 1992,8 euro; -0,36% A. Fill in the blanks below with the masculine and feminine, singular and plural forms of the possessive adjectives indicated. Some answers have been provided for you. I need help, please, I'm not that good at math Which TWO phrases from the text best support the answers to Part A? Do you guys have any idea how say my user lol?? What is the diference between thelargest and the smallest 4 digit numbers What is air??????????????