Name the part of the respiratory system which is shared with the digestive system. What is the common name of that part?

Answers

Answer 1
Answer:
The oropharynx is a passageway that is shared between the respiratory and digestive systems.

Related Questions

if an am radio station is emitting 10000 w in its 840-khz radio wave, how many photons is it emitting each second

Answers

The transmission will be seen as an electromagnetic wave. Radio antennas, like flashlights, emit lower energy photons that our eyes cannot see.

A cyclically alternating voltage causes electrons in the antenna's cables to jiggle back and forth. By the way, radio frequency photons have significantly less energy than visual photons. Yes, radio antennas can emit visible light, but most likely not in the way you expect. Through the process of thermal radiation, you can heat up a radio antenna until it glows and emits visible light if you apply enough energy to it.  Radio antennas, like flashlights, emit lower energy photons that our eyes cannot see.

Learn more about energy here-

https://brainly.com/question/29792091

#SPJ4

What is this formula used to find V Πr²h?

Answers

The formula V = π r² h is used to find the volume of a cylinder.

The volume of a cylinder refers to the density of the cylinder which indicates the amount of material it can hold or how much amount of any material can be immersed in it. To calculate a cylinder's volume, the formula to be used is v = π r² h. In this formula:

V signifies the volume of the cylinderπ r² represents the area of the base of the cylinder, where r is the radiush is the height of the cylinder

Hence, the required formula for the volume of a cylinder is V = π r² h.

You can learn more about volume of a cylinder at

https://brainly.com/question/24055431

#SPJ4

You push your physics book 1.50 M alone a horizontal tabletop with a horizontal push of 240 N while the opposing force of friction is 0.600 N. How much work does each of the following forces do on the book (a) your 2.40 N push, (b) the friction force (c) the normal force from the table, and (d) gravity? (e) what is the network done on the book?

Answers

a)Work performed by 2.4 N force: W = 3.6 J

b)work performed by o.6 N frictional force: W = -0.9 J

c) The normal force's work on the book, W = 0 J

d) Gravitational work on the book, W = 0 J

e) Work completed, W = 2.7 J

A force is an influence that has the power to alter an object's motion. A mass-containing object's velocity can be altered by a force. An obvious way to define force is as a push or a pull. Two surfaces that come into contact and glide against one another produce frictional force. The part of a contact force that is perpendicular to the surface that an item encounters is known as the normal force.Gravity, which means "weight" in Latin, is a basic force that attracts all objects with mass or energy to one another.The explanation is shown in the accompanying picture.

To know more about Gravity click here brainly.com/question/14874038

#SPJ4

different between force and work​

Answers

Answer:

What are your answer choices?

Explanation:

Work is like if you are a police officer you take down enemies. Force is like if you use a negatively charged balloon next to an uncharged piece of paper, they balloon would attract each other.

Hope this helps :D

How do you know what the safe load is for your boat to carry?

Answers

The best way to know what the safe load is for the boat is to calculate the buoyancy of the boat.

According to the Archimedes' principle, when a body is some merged in a liquid partially or fully, an upward force is applied on the body by the fluid that is equal to the weight of the fluid displaced by the body.

This upward force is called buoyancy.

As long as the weight of the lord on the boat is equal to the buoyancy of the boat it can we considered a safe load limit for the boat.

The buoyancy of the boat can be calculated by using the volume of the boat the density of the liquid in which the boat is going to serve and the acceleration due to gravity.

To know more about buoyancy, visit,

https://brainly.com/question/28464280

#SPJ4

Star Spectra Gizmo Unusual stars Observe the spectra of...
Star Spectra Gizmo Unusual stars
Observe the spectra of stars 5- 10. Identify the elements in each spectrum, and try to classify each star. If you notice unusual features in these spectra, describe them
Match : Write the number of the star or object that matches each description. Then use this information to help you identify the elements and reclassify the stars in the table above.
____ High atmospheric pressures in a star cause spectral lines to be broadened, or "smeared out." Giant stars , which have relatively low atmospheric pressures, are characterized by narrow spectral lines.
____ If a star is moving away from an observer, spectral lines are redshifted , or shifted toward the red end of the spectrum. An approaching star is blueshifted
____A star orbited by a large planet will move in a small circle. This will cause its spectrum to be slightly redshifted part of the time and blueshift ed at other times.
____Binary stars are pairs of stars that orbit one another. Their presence is indicated by two spectra that shift in opposite directions.
____ Cepheid variable stars change their brightness in a regular cycle. Gas pressure builds up, causing the stars to expand quickly. When the pressure is released, the star contracts, and the intensity of some spectral lines may decrease.
____A nebula is an enormous cloud of gas and dust in which stars are born. Most nebulae produce an emission spectrum which is characterized by bright lines of color against a dark background. The bright lines in an emission spectrum correspond to the dark lines in an absorption spectrum.

Answers

The number of star or object that matches each description are Giant stars, Redshifted and blueshifted spectral lines, Binary stars, Cepheid variable stars, and Nebulae and emission spectra.

Based on this information, you can classify the stars in the table as follows:

Star 5: Binary star (indicated by the presence of two spectra shifting in opposite directions)

Star 6: Cepheid variable star (indicated by the intensity of some spectral lines decreasing in a regular cycle)

Star 7: Giant star (indicated by narrow spectral lines due to low atmospheric pressures)

Star 8: Nebula (indicated by the presence of an emission spectrum with bright lines of color against a dark background)

Star 9: Star with redshifted spectral lines (indicated by the shift toward the red end of the spectrum)

Star 10: Star with blueshifted spectral lines (indicated by the shift toward the blue end of the spectrum)

Unusual features in these spectra could include the presence of two spectra shifting in opposite directions (indicating a binary star), the intensity of some spectral lines decreasing in a regular cycle (indicating a Cepheid variable star), or the presence of an emission spectrum with bright lines of color against a dark background (indicating a nebula).

Learn more about stars at

https://brainly.com/question/29359578?referrer=searchResults

#SPJ4

What is inverse variation examples?

Answers

The most common example of inverse variation is distance and speed. As the speed increases the distance decreases.

Unemployment and inflation have a well-known inverse relationship. When the value of one parameter rises while the value of the other decreases, the parameters, such as time and distance, are inversely connected. When x is not equal to zero and k is a nonzero real number constant, the nonlinear function known as inverse variation is described by the equation x y = k. If there is a nonzero constant k such that y = k x, then the variable y fluctuates directly as x. A link between two variables that can be mathematically described by an equation in which the product of the two variables equals a constant. The inverse of a trigonometric function, the inverse of a rational function, the inverse of a hyperbolic function, and the inverse of a spherical function.

to know more about inverse variation please visit.

https://brainly.com/question/11592410

#SPJ4

What is n equal to in math?

Answers

It serves as a shorthand for the collection of all natural numbers. Positive, non-zero whole numbers make up the natural numbers.

What does N look like as a number?

Natural Numbers (N) are the whole numbers 1, 2, 3, 4, and so on. They are also known as positive integers, counting numbers, or natural numbers (W). The collection of natural numbers is indicated. The letter n is used to begin the word number. This is why the n symbol is used in mathematics.

What does N in a sum mean?

The parameter n is referred to as the "index of summation." As you go from the first number to the last, replace the index of summation with consecutive integers to create the terms of a series expressed in sigma notation.

To know more about Natural Numbers visit:-

https://brainly.com/question/17429689

#SPJ4

Object A of mass 2 kg is gravitationally attracted to object B of mass 2 kg as the two objects float in space. Frictional forces are negligible. The gravitational forces of attraction between the two objects are shown in the table above. Which of these claims about the motion of the center of mass of the two objects system is true?
A) The center of mass will not accelerate
B) The center of mass will accelerate at 0.675 x 10 m/s?
C) The center of mass will accelerate at 5.4 x 10 m/s
D) The center of mass will accelerate at 2.7 x 10 m/s

Answers

The center of mass won't accelerate .Option (A)

Center of mass could be a position outlined relative to associate degree object or system of objects. it's the common position of all the components of the system, weighted consistent with their plenty.

from the question,

[tex]a_{com} = \frac{m_1a_1+m_2a_2}{m_1+m_2}[/tex]

the mass of the primary object is M1

the mass of the second object is M2

the acceleration of the primary object is a1

the acceleration of the second object is a2

acceleration (a) = force by mass

a = F/m

a1 = F/m1                                          

where F is force                                           ( F = [tex]2.7\times 10^{-10}[/tex])

a1 = [tex]\frac{2.7 \times 10^{-10}}{2 }[/tex]

a1 = [tex]1.35 \times 10^{-10} m/s^2[/tex]        ( towards right )

a2 = [tex]\frac{2.7 \times 10^{-10}}{2 }[/tex]

a2 = [tex]1.35 \times 10^{-10} m/s^2[/tex]          ( towards left)

so by this we can say this

a1 = [tex]+1.35 \times 10^{-10} m/s^2[/tex]

a2 = [tex]-1.35 \times 10^{-10} m/s^2[/tex]

to find the acceleration of center of mass

[tex]a_{com} = \frac{m_1a_1+m_2a_2}{m_1+m_2}[/tex]

[tex]a_{com} = \frac{2 \times 1.35 \times 10^{-10} -2\times1.35 \times 10^{-10} }{2+2}[/tex]

a = 0 / 4

a = 0

so by this we can say that

The center of mass will not accelerate

To learn more about center of mass:

https://brainly.com/question/26305980

#SPJ4

When loading passengers onto your boat where should you position them?

Answers

While loading the passengers on to the boat we should make sure that we position them write above the centre of mass of the boat.

The center of mass is a point in or outside anybody where we consider that the whole mass of the body is concentrated. We know that when are boat is hovering over a fluid it will experience some upward force which is equal to the mass of the fluid displaced by the boat.

When we position the passengers write about the centre of mass of the boat, we reduces the chance of disbalance of the boat by a very significant level.

To know more about center of mass, visit,

https://brainly.com/question/28865238

#SPJ4

A student conducts three experiments to determine how certain quantities influence the centripetal force responsible for an object to spin in a horizontal circle. The student uses one end of a string to attach the object while the other end is connected to a force sensor that allows the student to change the tension on the string, as shown in the figure. The student records data from the three experiments in the table above. Which of the following experiments, if any, collected data that do not agree with the expression for the net centripetal force on the object?

A)The experiment in which mass was changed
B)The experiment in which the radius of the circular path was changed
C)The experiment in which the speed of the object was changed
D)All the data are expected.

Answers

Option C) The experiment in which the speed of the object was changed

is only statement that doesn't satisfy the given data as shown below:

The above statement can be verified using the calculation:

Formula for centripetal force(F) = [tex]\frac{mv^2}{r}[/tex]

where m is mass of object , v is speed of object and r is radius of the circular motion.

For option A) when only mass of object is changed and rest all are same.

so F = k*m where k = [tex]\frac{v^2}{r}[/tex] as both are constant

=> [tex]\frac{F_1}{F_2}[/tex] = 4.04/8.08 = 0.5

and [tex]\frac{m_1}{m_2}[/tex] = 0.1/0.2 =0.5

so [tex]\frac{F_1}{F_2} = \frac{m_1}{m_2}[/tex]

similary [tex]\frac{F_2}{F_3} = \frac{m_2}{m_3}[/tex] and hence data is correct for option A)

For option B) when only radius of object is changed and rest all are

same.

so F = k/r where k = [tex]m*v^2[/tex] as both are constant

=> [tex]\frac{F_1}{F_2}[/tex] = 4.04/8.08 = 0.5

and [tex]\frac{r_2}{r_1}[/tex] = 0.3/0.6 =0.5

so [tex]\frac{F_1}{F_2} = \frac{r_2}{r_1}[/tex]

so both are same , similary [tex]\frac{F_2}{F_3} = \frac{r_3}{r_2}[/tex] and hence data is correct for option B

For option C) when only speed of object is changed and rest all are

same.

so F = k*[tex]v^2[/tex] where k = [tex]\frac{m}{r}[/tex] as both are constant

=> [tex]\frac{F_1}{F_2}[/tex] = 4.04/9.09 = 0.44444

and [tex]\frac{v_1^2}{v_2^2}[/tex] = 4.08/9.181 =0.44439

so ,[tex]\frac{F_1}{F_2}[/tex] ≠ [tex]\frac{v_1^2}{v_2^2}[/tex]

and hence data is not correct for option C

To know more about centripetal force click on below link:

https://brainly.com/question/11324711#

#SPJ4

Complete question:

A student conducts three experiments to determine how certain quantities influence the centripetal force responsible for an object to spin in a horizontal circle. The student uses one end of a string to attach the object while the other end is connected to a force sensor that allows the student to change the tension on the string, as shown in the figure. The student records data from the three experiments in the table above. Which of the following experiments, if any, collected data that do not agree with the expression for the net centripetal force on the object?

A)The experiment in which mass was changed

B)The experiment in which the radius of the circular path was changed

C)The experiment in which the speed of the object was changed

D)All the data are expected.

What device maps the ocean floor?

Answers

Scientists utilize the EM300 device to produce exact maps of the a seafloor.The EM300 can operate in water as shallow as 10 meters and as deep as 5000 meters.

How does the device that maps on ocean floor appear?

Dive and Discover:Sonar is used in oceanographic research.Today, echo sounding is the primary method used by scientists for map the seafloor.

How is technology used to study the ocean floor?

Today, sonar aids in the creation of bottom maps, buoys and water depth samplers are used to track the effects of sea level changes on water quality parameters, coring devices collect samples of sediment, and remotely operated vehicles (ROVs) enable everybody to effectively and safely discover any oceanic region.

To know more about ocean floor visit:

https://brainly.com/question/9046600

#SPJ4

a wooden block of mass 1200g, which moves on a horizontal surface, is subjected to a frictional force of 3 N. How much frictional force will act on the block if we put a 500g weight on it?​

Answers

Answer:

Approximately [tex]4.25\; {\rm N}[/tex] as long as the wooden block continues moving.

Explanation:

Since the wooden block is moving, the friction on the block will be kinetic friction. This friction will be proportional to the magnitude of the normal force on the block. Specifically:

[tex]\begin{aligned}& (\text{kinetic friction}) \\ =\; & (\text{normal force})\, (\text{kinetic friction coefficient $\mu_{k}$}) \end{aligned}[/tex].

In this question, since the surface is horizontal, the only vertical forces on this block will be:

Weight of the block [tex](\text{weight}) = (\text{mass})\, g[/tex] where [tex]g[/tex] is the gravitational field strength, andNormal force on the block.

These two forces will balance each other. Thus, [tex](\text{normal force}) = (\text{weight})[/tex].

[tex]\begin{aligned}(\text{normal force}) &= (\text{weight}) \\ &= (\text{mass})\, g\end{aligned}[/tex].

Substitute to obtain:

[tex]\begin{aligned}& (\text{kinetic friction}) \\ =\; & (\text{normal force})\, (\text{kinetic friction coefficient $\mu_{k}$}) \\ =\; & (\text{mass})\, (\text{kinetic friction coefficient $\mu_{k}$})\, g\end{aligned}[/tex].

In other words, the kinetic friction on the block is proportional to the mass. As long as the block continues moving, increasing mass from [tex]1200\; {\rm g}[/tex] to [tex](1200 + 500)\; {\rm g} = 1700\; {\rm g}[/tex] will increase friction to [tex](1700 / 1200) = (17/12)[/tex] the initial value, [tex](17/12)\, (3\; {\rm N}) \approx 4.25\; {\rm N}[/tex].

How do you calculate the current measured by ammeter?

Answers

The resistance R divided by the potential difference V yields the current I. We simply need to determine the potential difference and resistance of the circuit in order to determine the current in this ammeter, which measures the current of the circuit.

How does an ammeter calculate current?

The ammeter is linked to the circuit in series. Therefore, its reading will reflect the amount of current flowing through the circuit. Consequently, the ammeter's reading is 1A.

How do you figure out current?

We can easily calculate current by dividing the total charge by the measurement period. I = Q t, where I stands for current, Q for charge, and t for time, is a formula for calculating current.

To know more about ammeter visit :-

https://brainly.com/question/22787866

#SPJ4

At the top of a roller coaster there is a cabin whose mass is 100 kg at a height of 40 m and with a speed of 5 m/s.

A. Calculate its mechanical energy.

(Please help!)

Answers

At the top of a roller coaster there is a cabin whose mass is 100 kg at a height of 40 m and with a speed of 5 m/s, its mechanical energy becomes: 40450 J

What is mechanical energy?

Mechanical energy, also known as kinetic energy or potential energy, is the energy that an item possesses when it is in motion or the energy that an object stores due to its location. Renewable energy is also fueled by mechanical energy.

In order to efficiently create electricity or convert energy, many sources of renewable energy depend on mechanical energy.

A compressed spring, for instance, has mechanical energy in the form of potential energy, whereas a moving vehicle has mechanical energy in the form of kinetic energy.

Given that,

mass (m) = 100 kg

speed (v) = 5 m/s

height (h) = 40 m

Total mechanical energy of the roller coaster at point A

= Potential energy at point A + Kinetic energy at point A

= mgh + (1/2)mv²

= (100×9.8×40)+ [0.5×100×(5)²]

= 39200 + 1250

= 40450 J (Answer)

To know more about mechanical energy refer to:

https://brainly.com/question/2856050

#SPJ1

What are 3 qualities of realism?

Answers

During the height of the development of that form, realism's emphasis on objectivity, detachment, and accurate observation, as well as its clear but restrained criticism of social norms and environments, and the humane understanding that underlay its moral judgments, all played a significant role in the development of the modern novel.

What constitutes realism as a whole?

Realistic thinking centered on portraying everyday reality in its truest form. Realistic thinking is concerned with the present moment, with actual events and their verifiable results. Realism aims for a one-to-one correspondence between the topic and the depiction. It also goes by the name mimesis.

Which of these three types of realism are they?

Three schools of realist thought exist: human nature realism, state-centric realism, and system-centric realism.

To know more about realism visit:-

https://brainly.com/question/13981459

#SPJ4

2. A rifle can shoot a 4.00 g bullet at a speed of 998 m/s.
a. Find the kinetic energy of the bullet.
b. What work is done on the bullet if it starts from rest?
c. If the work is done over a distance of 0.75 m, what is the average
force on the bullet?
d. If the bullet comes to rest after penetrating 1.50 cm into a piece of
metal, what is the magnitude of the force bringing it to rest?
Posted Thu Oct 27, 2022 at 9:11 am

Answers

a) The kinetic energy of the bullet is 1.996 joule.

b) The total work done on it is 1.996 joule.

c)  The average force on the bullet is 2.661 N.

d) The  magnitude of the force bringing it to rest is 1.33 N.

What is speed?

Speed is distance travelled by the object per unit time. Due to having no direction and only having magnitude, speed is a scalar quantity With SI unit meter/second.

Given that: . A rifle can shoot a 4.00 g bullet at a speed of 998 m/s.

a) the kinetic energy of the bullet = (4.00/1000)×998/2 joule = 1.996 joule.

b)  If it starts from rest, the total work done on it = kinetic energy of it = 1.996 joule.

c) If the work is done over a distance of 0.75 m, the average force on the bullet is = work done/distance =  1.996/0.75  N = 2.661 N.

d)  If the bullet comes to rest after penetrating 1.50 cm into a piece of

metal, the magnitude of the force bringing it to rest is = 1.996/1.50 N = 1.33 N.

Learn more about speed here:

https://brainly.com/question/28224010

#SPJ1

What is the correct formula for wavelength as a function of energy?

Answers

The relationship between wavelength, energy, and frequency is expressed by the formula E = hv = hc/, where E is energy, h is Planck's constant, v is frequency, c is the speed of light, and w is wavelength.

How do you determine a function's wavelength? The relationship between wavelength, energy, and frequency is expressed by the formula E = hv = hc/, where E is energy, h is Planck's constant, v is frequency, c is the speed of light, and w is wavelength. The formula wavelength = wave velocity/frequency can be used to determine wavelength.Wavelength is typically measured in meters.Greek lambda is the sign for wavelength, therefore = v/f.Wavelength and frequency have a connection to energy just as they do to light.Higher frequency and shorter wavelengths are correlated with more energy.Therefore, lower energy is produced when the wavelengths are longer and the frequency is lower.E = h is the formula for energy.

To learn more about wavelength refer

https://brainly.com/question/10728818

#SPJ4

What are some of the safety procedures to follow when refueling?

Answers

The safety procedures to follow when refueling includes emptying the vehicle and turning of the engine.

Some certain safety procedures has to be followed while refueling the vehicle.

1. We have to make sure that we turn off the engine while refueling because keeping the engine on while refueling can give price to an unexpected explosion.

2. There are certain vehicles that have the gas cylinders in them as a fuel tank, in these cases we have to make sure that there is no one sitting inside the car while refueling. Doing this is not an economical thing and also it can give rise to certain unexpected accidents.

To know more about safety measures while refilling, visit,

https://brainly.com/question/17016429

#SPJ4

a 700 kg elevator starts from rest. it moves upward for 2.50 s with constant acceleration until it reaches its cruising speed, 1.75 m/s. (a) what is the average power of the elevator motor during this period? correct: your answer is correct. w (b) how does this power compare with the motor power when the elevator moves at its cruising speed? pcruising

Answers

(a) The average power of the elevator motor during this period will be 6431.25 W

(b) Power delivered by the motor during Constant speed motion. is greater than power delivered during moving at a Constant acceleration

Mass of elevator. m=700 kg

Initial velocity.u =0 m/ s

Final velocity v=1.75 m/ s

time [tex]\Delta t[/tex] =2.5 sec

(a) Average power of elevator motor the this during Period [tex]P{avg =\frac{w}{\Delta t}[/tex]

We know [tex]W=F\cdot d \cos \theta[/tex]

[tex]W_{motor }=F_{motor } d \cos 0^{\circ}[/tex]

W_{motor}=F_{motor } d

Net force = F_{net}=F_{motor}mg

As per Newton's Second Law ma =F_ {motor }-mg

Now applying the equation of motion: v=u+at

1.75=0+a*2.5 =>a=0.7 m/s^2

[tex]F_ {motor}=Ma+g=700(0.7+9.8) \\\Rightarrow F_ {motor}=7350 ~N\\d=ut+\frac{1}{2} \times a \times t}^2\\\Rightarrow d=0 t+\frac{1}{2} \times 0.7(2.5)^2\\d}=2.1875 m[/tex]

[tex]W_{motor}=F_{motor} \times d=7350 \times 2.1875=16078.125 J\\P_ {avg }=\frac{W_{motor }}\Delta t}=\frac{16078.125}{2.5}=6431.25 W[/tex]

B) if the elevator is Constant with moving up speed

F_{net}=F_{motor }-mg

But a =0

So, F_motor=mg = 700*9.8=6860 N

So, the value of the distance moved will be:

[tex]\triangle \mathrm{x}=\mathrm{vt}=1.75 \times 2.5=4.375 \mathrm{~m}\\\\\mathrm{~W}_{\text {motor }}=\mathrm{F}_{\text {motor }} \Delta \mathrm{x}=7350 \times 4.375=32156.25 \mathrm{~J}\\\\\mathrm{P}_{\text {avg }}=\frac{32156.25}{2.5}=12865.5\mathrm{w}\\\\[/tex]

[tex]\frac{\left(\mathrm{p}_{\text {avg }}\right) \mathrm{a}}{\left(\mathrm{p}a_{\text {avg }}\right) \mathrm{b}}=\frac{6431.25}{12865.5},\left(\mathrm{p}_{\text {avg }}\right) \mathrm{a}=0.499 \times\left(\mathrm{p}_{\mathrm{avg}}\right) \mathrm{b}[/tex]

For more questions on Elevators:

https://brainly.com/question/28694625

#SPJ4

Why are some genetic diseases common?

Answers

A certain genetic ailment might be more prevalent in the group if one of these common genes contains a disease-causing variant (also known as a mutation).

How widespread are genetic disorders?

A genetically based ailment will affect roughly 6 out of every 10 individuals. From minor to extremely severe genetic disorders are possible. It is believed that a delicate balance between mutation, genetic drift, and natural selection is the main reason why diseases continue to affect human populations.

Why do some genetic features tend to be more prevalent?

How many copies of that gene variant (or allele) are present in the population determines how frequent a trait is. Whether a trait is dominant or recessive has little to no bearing on this.

To know more about genetic visit:-

https://brainly.com/question/28980835

#SPJ4

According to newton's third law, what is the equal and opposite force to the downward force of gravity pulling on a man standing on the beach?.

Answers

According to newton's third law, what is the equal and opposite force to the downward force of gravity pulling on a man standing on the beach?

[tex]\fbox{The man pulling upward on earth}[/tex]

What happens to waves when they pass through a narrow opening?

Answers

The act of waves spreading out after passing through a tight opening happens when they cross the edge of a surface, as they are twisted around an object, and as they pass through the aperture's narrow opening. phenomenon where the amplitudes of two or more waves combine.

What happens when a wave enters a narrow passageway?

When a wave runs into a minor obstruction or an opening, it may bend to get around it or pass through it before spreading out. The term "diffraction" refers to this bending or spreading out.

What occurs to waves when they pass through a barrier with a small opening?

A wave that runs into a minor obstruction will typically bend around it. Diffraction is the name given to this wavefront bending.

To know more about waves visit :-

https://brainly.com/question/3639648

#SPJ4

What are 3 sources of carbon dioxide emissions?

Answers

These sources can be found primarily in three different contexts: industrial processes, natural gas processing, and fuel combustion activities.

Where do the majority of the carbon dioxide emissions come from?

CO2, or carbon dioxideThe main source of CO2 is the burning of fossil fuels.Indirect human-induced effects on forestry as well as other land uses, such as deforestation, clearing land for agriculture, and soil deterioration, can indirectly release CO2.

What are the planet's two primary sources of carbon dioxide?

There are two main sources of atmospheric carbon dioxide: natural processes and human activity.The majority of animals, who exhale in the form of a waste product, are natural sources of dioxide.

To know more about emissions visit:

https://brainly.com/question/517329

#SPJ4

After the core of a massive star becomes a neutron star, the rest of the star’s material

a. Continues regular fusion and returns to the main sequence
b. Is vaporized by the incredible heat of the dying star and is ejected outward
c. Falls inward and gets compressed to incredible densities.
d. Makes a planetary nebula, which gently moves outward from the center

Answers

After the core of a massive star becomes a neutron star, the rest of the star’s material falls inward and gets compressed to incredible densities.

The correct option is C.

What is considered a massive star?

Star which is larger than eight solar masses during its regular main sequence lifetime is considered a massive star.

Massive stars typically have a quick main sequence phase, a short red supergiant phase, and a spectacular death via a supernova explosion.

If the core of a massive star becomes a neutron star, the rest of the star’s material is known be be compressed to incredible densities.

Learn more about massive stars at:  https://brainly.com/question/12732300

#SPJ1

a motorized cable moves a 2000kg elevator upwards at constant velocity for 10m.a) what is the work done by the motor?

Answers

The work done by the motor is 196×10⁴Joules, if a motorized cable moves a 2000kg elevator upwards for 10m.

We know that from The work-energy hypothesis, otherwise called the rule of work and dynamic energy, expresses that the all out work done by the amount of the multitude of powers following up on a molecule is equivalent to the adjustment of the motor energy of that molecule. This clarification can be reached out to inflexible bodies by portraying crafted by rotational motor energy and force

In order words, W=F.dx

where F is the force applied on the body, dx is the displacement of the body.

Now, for calculating force we know that gravity is acting on it

So, force applied on the body is =mg where m is the mass and g is acceleration due to gravity.

We have m=2000kg and g=9.8m/sec²

So, value of mg=2000×9.8=19600.0=19600N

Now, we have displacement(dx)=10m

So, work done=196000 × 10=1960000Joules or 196×10⁴Joules.

To know more about work, visit here:

https://brainly.com/question/454872

#SPJ4

Compared with the orbits of the short-period comets, the orbits of long-period comets

(a) tend to lie in the plane of the ecliptic
(b) look like short-period orbits, but are simply much larger
(c) are much less eccentric
(d) can come from all directions

Answers

Compared with the orbits of the short period comets, the orbits of long period comets can come from all directions.

Short period comets come from the kuiper belt. Comets of long period come from the ort cloud which is a cloud debris surrounding the sun at a distance of 1 light year.

Long period comets have orbital period more than 200 years. Their orbits are inclined in the ecliptic plane. They may be perturbed by a passing star. Their orbits are highly inclined because of spherical origin.

They can be seen in night sky with much brilliance. Their brilliance is because thy have not passed from inner solar system.

Short period comets have orbital period less than 200 years. Haily type comets are example of short period comets.

To know more about comets here

brainly.com/question/12443607

#SPJ4

A 20 kilogram ball rolls down a ramp and accelerates at a rate of 12 m/s per second. what is the net force acting on the ball?

Answers

The net force on 20 kilogram ball rolling down the ramp is 240 N.

Newton's law relates the acceleration of the ball and mass of ball. The relationship or formula between the two is as follows -

F = ma, where F is force, m is mass of ball and a is the acceleration of ball. Keep the values in formula to find the net force acting on the ball.

Force acting on the ball = 20 × 12

Performing multiplication on Right Hand Side of the equation

Force acting on the ball = 240 N

Thus, the force ont the ball is 240 N.

Learn more about force -

https://brainly.com/question/12785175

#SPJ4

What happens during 1/2 life of a radioactive isotope?

Answers

A radioactive isotope's half-life is the length of time it takes for one half of it to decay.

What is the radioisotopes' half-life?

The duration needed for a quantity of a radioisotope to decay by half is known as its radioactive half-life. If an isotope has a half-life of only a few hours or less, the majority of the radioactivity will dissipate within a few days.

How does half-life work?

A radioactive element's half-life is the amount of time it takes for it to decay to half of its original value. It can be concluded from this that a source's activity has a half-life if it takes some time before it drops to half its starting value.

To know more about radioactive half-life visit:-

https://brainly.com/question/9941859

#SPJ4

1.The discontinuity effect is caused primarily by _________.Group of answer choicesnormative social influence and informational social influencefear and greedcoordination loss and reduced effortreduced evaluation apprehension and attitude polarizationdeindividuation and reduced evaluation apprehension2.Research has found that if you put people into two different groups, even if the basis is completely arbitrary (such as a coin flip), people will give preference (such as more money) to their own group over the other group. This is called ________ and it is one component of ________.Group of answer choicesthe illusory correlation; realistic group conflict theory.the minimal group paradigm; social identity theory.outgroup polarization; realistic group conflict theory.the illusory correlation; social identity theory.outgroup polarization; ethnocentrism3.

Answers

Jump, endless, detachable, endpoint, and mixed discontinuities can all be categorised. The existence of the limit is a characteristic of removable discontinuities.

Redefining the function is one way to "repair" removable discontinuities. Endpoint Discontinuities: There is only one one-sided limit. Mixed: None of the one-sided constraints exist, at least in part. Below is a graph of f (x), which demonstrates a function that discontinues when x = a. Mixed: None of the one-sided constraints exist, at least in part. Both one-sided limits are present in 1 Jump Discontinuities, although they have distinct values. Both one-sided limits are infinite, resulting in two infinite discontinuities. Three endpoint discontinuities: There is only one one-sided limit. 4 Mixed: None of the one-sided constraints exist, at least in part.

To learn more about discontinuities please click on below link

https://brainly.com/question/29083468

#SPJ4

Other Questions
A certain math test has a mean of 50 and a standard deviation of 12. the teacher wants to convert the scores to a new scale using the transformation x*=65+0.6x. what are the new mean and standard deviation?a) mean=50, standard deviation=7.2b) mean=95, standard deviation=7.2c) mean=95, standard deviation=12d) mean=95, standard deviation=72.2e) mean=77, standard deviation=12 What are the 3 phases of compliance? pls help me i will mark brainliest:)Simplify 5g(3g + 4).15g + 415g 20g15g2 + 415g2 20g Solve |2x - 2 6.A. x-2 or x 4B. x 3 or x 5C. x -2 or x 5D. x -2 or x 6 What does associative property look like? Why was the Scientific Revolution so impactful? Predict what happens to the mechanical advantage of a machine if friction is reduced through the use of oil or some other means. How did the literature of the northern renaissance reflect a movement towards secularism. Ellen riley is a district general manager who has been contacted by the local newspaper and tv stations about the recent identity thefts that occurred at some competitor locations in town. the reporters are looking for information on what steps Electronic rack-and-pinion systems use an electric motor to pump the hydraulic fluid through the hoses.a. trueb. false For each set of numbers find the mean (average).6, 12, 10, 8 Polyvinyl chloride (PVC) is one of the most commercially important polymers. PVC is made by addition polymerization of vinyl chloride ( C2H3Cl ). Vinyl chloride is synthesized from ethylene ( C2H4 ) in a two-step process involving the following equilibria:Equilibrium 1: C2H4(g)+Cl2(g)C2H4Cl2(g) Equilibrium 2: C2H4Cl2(g)C2H3Cl(g)+HCl(g)Use bond energies to estimate the enthalpy change, rH for Equilibrium 1.Polyvinyl chloride (PVC) is one of the most commercially important polymers. PVC is made by addition polymerization of vinyl chloride ( C2H3Cl ). Vinyl chloride is synthesized from ethylene ( C2H4 ) in a two-step process involving the following equilibria:Equilibrium 1: C2H4(g)+Cl2(g)C2H4Cl2(g) Equilibrium 2: C2H4Cl2(g)C2H3Cl(g)+HCl(g) Part BUse bond energies to estimate the enthalpy change, rH for Equilibrium 1.Part CUse bond energies to estimate the enthalpy change, rH , for Equilibrium 2. What additional information is needed to show that ABC DEF by SSS? the set of efficient points is best described as a.only area i: points inside the ppf. b.area i: inside the ppf and points on the ppf. c.area o: outside the ppf and points on the ppf. d.only area o: points outside the production possibilities frontier (ppf). e.only points on the ppf What is 3 5 equivalent to as a fraction? In triangle ABC acute angles are in the ratio 5:1, i.e. The SQL command that lets you select attributes from rows in one or more tables or views is ____.a. INSERTb. SELECTc. COMMITd. UPDATE help multipylook at the picture What makes similar shapes similar? A cuboid has a lateral surface of 260 cm and a height of 10 cm. The dimensions of the base are: one is 3 cm smaller than the other. Instruction: First, we find the perimeter of the base of the cuboid as a ratio of the side surface to the height. (260cm2: 10cm=26 cm.) Then we write the equation x+x-3+x+x-3=26cm, where with x we marked one of the sides, we find the sides