PLEASE HELP

Discussion: If you put something like a piece of cardboard between a magnet and an iron nail, the magnet still holds the nail in place, even though the magnet is not touching the nail Explain how that happens. Use the words induce, magnetic field, permanent magnet and temporary magnet in your response.​

Answers

Answer 1
The magnetic field is holding onto the nail that’s all I got

Related Questions

from readong these two paragraph only the best description of Austin is that he is a ___ character

Answers

Explanation:

may you send the paragraph pic please im curious as to the answer too

Answer:

can I get the passage please

how does the size of the solar system compare to the Milky Way galaxy?
1. the solar system is larger
2. the solar system is the same size
3. the solar system is much smaller
4. the solar system is about one half the size

Answers

Answer:

either 3 or 4 most likely 3

Explanation:

4 is Half the size because the solar is 200 and milky is 400 so half

50 POINTS PLSS
Your car is initially at rest when your hit that gas and the car begins to accelerate at a rate of 2.857 m/s/s. The acceleration lasts for 15.5 s. What is the final speed of the car and how much ground does it cover during this acceleration?

Answers

Answer:I think the answer is 5.43 I don’t rlly know

Explanation:

Explain which planets have seasons and why some planets have none at all.

Discuss which planet has seasons most similar to earth and why.

Discuss additional factors that some planets have that affect their seasons.

What fact about other planet’s seasons most surprised you and what did you find the most interesting? Why?

Answers

Answer:

Some planets have seasons some don't bc of the distance from the sun some of them are too cold or too hot to have seasons

SOMEONE PLEASE PLEASE HELP QUICK PICTURE INCLUDED

Answers

Answer:

A

Explanation:

Switches are used to block electrical currents, thus needing to be made out of insulating material.

can you describe your own perspective whats Physical Science all about? PLS GUYS HELP​

Answers

Answer:

Physical science is the study of the inorganic world. That is, it does not study living things.  The four main branches of physical science are astronomy, physics, chemistry, and the Earth sciences, which include meteorology and geology.

Which pair of factors affects the force of gravity between objects?

direction and distance

mass and distance

mass and shape

shape and time

Answers

Answer:

mass and distance

Explanation:

dont need to summary this

Answer:

B. mass and distance

Explanation:

What is the correct order of organization from smallest to largest?

a.Tissues, cells, organs, organism, organ system
b.Cells, organs, tissues, organ system, organism
c.Organs, tissues, organ system, cells, organism
d.Cells, tissues, organs, organ system, organism

Answers

Answer:

D

Explanation:

Cells are the smallest unit of organizaiton, followed by tissues, organs, organ systems, and then organisms themselves.

1. Suppose you have a metal bar. Its mass is 57.9g and its volume is 3cm'. What is its
density?

Answers

¡Hellow!

How we know, for calculate density, we can use the formule:

                                               [tex]\boxed{\textbf{p = m / v} }[/tex]

Where:

[tex]\sqrt{[/tex] p = Density = ?

[tex]\sqrt{[/tex] m = Mass = 57,9 g

[tex]\sqrt{[/tex] v = Volume = 3 cm³

Let's replace according we information:

p = 57,9 g / 3 cm³

p = 19,3 g/cm³

The density of the metal bar is 19,3 g/cm³.

¿Good luck?

A rock climber is going up a narrow space between two vertical rocks. The distance between the rocks allows the climber to brace herself using friction, where her feet are flat and in contact with one rock to the left, and her legs are straight horizontal and her back is flat against a rock on the right. The coefficient of static friction between her shoes and the rock on the left is 1.2, and between the rock at right and her back is 0.8. The climber relaxes until she is on the verge of slipping on both sides.
(a) Draw a FBD for the climber
(b) What fraction of her weight is supported by the frictional force on her shoes?

Answers

Answer: b

Explanation:

A block is attached to one end of a spring with the other end of the spring fixed to a wall. The block is vibrating horizontally on a frictionless surface. If the mass of the block is 4.0 kg, the spring constant is k

Answers

Complete Question

A block is attached to one end of a spring with the other end of the spring fixed to a wall. The block is vibrating horizontally on a frictionless surface. If the mass of the block is 4.0 kg, the spring constant is k = 100 N/m, and the maximum distance of the block from the equilibrium position is 20 cm, what is the speed of the block at an instant when it is a distance of 16 cm from the equilibrium position?

Answer:

The velocity is [tex]v = 0.6 \ m/s[/tex]

Explanation:

From the question we are told that

  The mass of the block is  m =  4.0 kg

  The spring constant is k =  100 N/m

  The maximum distance of the block from equilibrium position is  d = 20 cm =0.20 m

   The distance considered is  [tex]d_k = 16 \ cm = 0.16 \ m[/tex]

Generally the maximum energy stored in the spring is mathematically represented as

      [tex]E = \frac{1}{2} * k * d^2[/tex]

=>  [tex]E = \frac{1}{2} *100 * 0.2^2[/tex]

=>  [tex]E = 2.0 \ J[/tex]

Gnerally according to the law of energy conservation

   The energy maximum energy of  the spring = energy of  the spring at [tex]d_k[/tex] + energy of the block at [tex]d_k[/tex]

Here energy of the block at [tex]d_k[/tex] is mathematically represented as

        [tex]K_1 = \frac{1}{2} mv^2[/tex]

=>    [tex]K_1 = \frac{1}{2} * 4* v^2[/tex]

=>    [tex]K_1 = 2v^2[/tex]

Generally the energy of the spring at [tex]d_k[/tex] is mathematically represented as

      [tex]E_2 =\frac{1}{2} * k * d_k^2[/tex]

=>    [tex]E_2 =\frac{1}{2} * 100 * (0.16)^2[/tex]

=>    [tex]E_2 =1.28 \ J[/tex]

So

       [tex]2.0 = 1.28 + 2v^2[/tex]

=>    [tex]v = 0.6 \ m/s[/tex]

     

   

Hellllllpppppp what happens

Answers

Answer:

u can write ur answer and submit it

its a test

The resultant force is equel to the.......of all the force


A) sum
B) product
C) subtraction
D) Division​

Answers

Answer:

A) sum

Explanation:

That's the answer bro

Answer:

the answer is C subtraction

An airplane is flying at a velocity of 79 m/s eastward relative to the air. Due to a high-pressure region to the north, the velocity of the air relative to the ground is 18 m/s southward. Find the ground speed of the airplane.

Answers

So we are working out it’s final velocity. To do this you need to rearrange and substitute :
Velocity = final velocity (v) - initial vel. (U)
Divided by ______________________
Time taken (t)

Not sure if this helped but I try to start it off

A large mining dump truck has a mass of 40,000 kg. If its engine produces
20,000N of force, how fast will the truck accelerate?

Answers

Answer:

0.5 m/s²

Explanation:

Net force = mass × acceleration

∑F = ma

20,000 N = (40,000 kg) a

a = 0.5 m/s²

Answer:

which one will not start moving faster

Explanation:

Mass is also described by physics. If you apply the same amount of force to a small sports car and to a big garbage truck.

The student toses a ball into the air and then watches the ball fall back down to earth. When does the ball have the most potential energy

Answers

Answer:

when the ball is at its highest in the air.

Explanation:

I don't know for sure, but when the ball is in the air it has potential energy to fall(or something like that).


Select the correct answer from each drop-down menu.
Rocky metallic objects found between the orbits of Mars and Jupiter are(drop down). The largest known of these is(drop down).

Answers

Answer:

Blank 1 (asteroids)

Blank 2 (Ceres)

Explanation:

Rocky metallic objects found between the orbits of Mars and Jupiter are asteroids The largest known of these is ceres.

What are asteroids?

Asteroids are stony elements that circle the Sun. Although asteroids circle the Sun in the same way as planets, they are considerably smaller.]

A dwarf planet located between Mars and Jupiter in the asteroid belt. Ceres was the first asteroid discovered, it was originally classed as a planet,

Rocky metallic objects found between the orbits of Mars and Jupiter are asteroids The largest known of these is ceres.

The correct option from the drop-down menu is asteroids and ceres.

To learn more about the asteroids refer to the link;

https://brainly.com/question/19161842

Which could describe the properties of sedimentary rock?
PLASE HELP
DUE TODAY

Answers

Answer:

☝ Some of the properties of sedimentary rocks

A force vector has a magnitude of 42 N and is applied at an angle of 108°
above the eastern horizontal.. Determine they component of this force
vector
0 -15 N
O -13 N
39.9 N
35 N

Answers

7(&6747485!?68668 i yuhh join j

5. Why should the free ends of a conduction tester not be connected for a long
time?​

Answers

If the free ends of conduction tester are connected for long time , The cell of the battery will drain very quickly

A 65.25 kg person holding a steel ball stands motionless on a frozen lake.
The person then throws the ball, which propels the person at 1.25 m/s to the
right and the ball 4.05 m/s to the left. If the initial momentum of the system is
zero, what is the mass of the steel ball?

Answers

Answer:

20.14 KG

Explanation:

apex keepy o heads up stay positive don't stress over something useless big future 4 all of yall!

The mass is 20.14 kg

The path of a projectile fired at an angle above the horizontal is best described as

Answers

I agree it only makes sense

Which of the following fields can only exist in one direction?

Answers

It’s B hope it helps

Like chargers attract one another

Answers

nope. opposite charges attract. like charges repel.

Which Statement describes Newton's law of universal gravitation?

Mass has little effect on gravity between objects

gravity pushes objects away from Earth's center

gravity does not act between Earth and Moon

every object in the universe attracts every other objects

>You will get 100 points for answering this!

Answers

Answer:

The answer is D, every object in the universe attracts every other objects

Explanation:

Newton's law of universal gravitation is described as every object in the universe attracts every other objects.

What is gravitation?

Gravitation is the force in physics that draws two masses together. Unbelievably, every single particle of matter in the cosmos attracts every other particle through gravity. The phrases gravitation and gravity are sometimes used synonymously to refer to the attraction that exists between everything with mass or energy.

According to Newton's Law of Universal Gravitation, every particle in the cosmos is drawn to every other particle with a force that is directly proportional to the product of their masses and inversely proportional to their distance from one another.

So, every object in the universe attracts every other objects describes  Newton's law of universal gravitation.

Learn more about gravitational force here:

https://brainly.com/question/3009841

#SPJ6

Which landform represents a piece of land that is formed when a river splits before flowing into the ocean?

Delta
Glacier
Lake
Mountain

Answers

I think the answer is a delta but I could be wrong

Answer:

delta

Explanation:i just got it right

I will give you branilest!
A 1500 kg car accelerates at a rate of 3.0 m/s2. How much force is the car's engine producing?

Explain.

Answers

Hellow!

First, lets recabe information:

m (mass) = 1500 kg

a (aceleration) = 3 m/s²

F (Force) = ?

For calculate Force, if we have mass and aceleration, we can applicate the second law of Newton:

"Force is proportional to the product of the mass plus aceleration."

In a equation, this is like:

F = m * a

Let's replace according we information, and let's resolve:

F = 1500 kg * 3 m/s²

F = 4500 N

Result:

The force applicated is of 4500 Newtons.

Gud Luck!


2) A boat travels 12.0 m while it reduces its velocity from 9.5 m/s to 5.5 m/s. What is the
boat's acceleration while it travels that distance?

Answers

Answer:

2.5m/s^2

Explanation:

Note that the boat is reducing its speed. It is having negative acceleration or deceleration.

V^2 = u^2 -2as ( minus sign is used because of speed is reduced)

Given that,

s = 12 m

v = 5.5 m/s

u = 9.5 m/s

a = (v^2 - u^2) ÷ (-2s)

a= ( 5.5^2 - 9.5^2) ÷ ( -2× 12)

a = 2.5 m/s^2

The acceleration of the boat is -2.5 m/s²

The given paramters;

distance traveled by the boat, d = 12 m

initial velocity of the boat, u = 9.5 m/s

final velocity of the boat, v = 5.5 m/s

The acceleration of the boat is calculated as;

[tex]v^2 = u^2 + 2as\\\\2as = v^2 - u^2\\\\a = \frac{v^2 - u^2}{2s} \\\\a = \frac{(5.5)^2 -(9.5)^2 }{2(12)} \\\\a = -2.5 \ m/s^2[/tex]

Thus, the deceleration of the boat is 2.5 m/s²

Learn more here: https://brainly.com/question/17352997

An Astronaut on the Moon drops a rock straight downward from a height of 1.25 meters. If the acceleration of gravity on the Moon is 1.62 meters per second squared, what is the speed of the rock just before it lands?

Answers

Answer:

Since the astronaut drops the rock, the initial velocity of the rock is 0 m/s

We are given:

initial velocity (u) = 0 m/s

final velocity (v) = v m/s

acceleration (a) = 1.62 m/s/s

height (h) = 1.25 m

Solving for v:

From the third equation of motion:

v²-u² = 2ah

replacing the variables

v² - (0)² =2 (1.62)(1.25)

v² = 1.62 * 2.5

v² = 4 (approx)

v = √4

v = 2 m/s

The speed of the rock just before it lands is 2 m/s

Which pairs of elements could not react to form an Ionic compound

Answers

Answer:

Sodium and calcium

Explanation:

Answer:

Ionic bond is the name given to one of the three ways in which atoms can interact with each other. The other forms of interaction between atoms are the covalent bond, which occurs between atoms of ametals, hydrogens, or ametal and hydrogen, and the metallic bond, which occurs only between atoms of the same metal.

Explanation

:The atoms of the chemical elements that participate in the ionic bond must present, necessarily, the nature of gaining or losing electrons, thus, the ionic bond can occur between:

a metal and an ametal;

a metal and hydrogen.

Sodium: metallic element, as it has the characteristic of losing electron; belonging to the IA family, atomic number 11, with an electron in the valence shell.

Chlorine: ametalic element, as it has the characteristic of gaining electrons; belonging to the VIIA family, with atomic number 17.

Other Questions
What happened to the greenish warbler birds as they migrated from the southern portion of their range up around the Tibetan Plateau? a. They evolved separately as they moved north and became two separate species. b. The original species died off, but the ones that were able to adapt to a northern climate evolved into a new species. c. As a whole the species was able to adapt to a colder climate, but no significant changes occurred. d. They were unable to adapt and evolve to ensure their survival and became extinct. Please select the best answer from the choices provided A B C D Which chronic condition is known as the "silent" disease? What is Newtons second law of motion and what is the formula Which of the following is equal to 1/2 or -1/2? Check all that apply.sin(7pi/6)Sin(4pi/3) Cos(5pi/3)Cos(pi/6)Cos(5pi/6)Sin(5pi/6) Hey can anyone help me please i so confused on this and it due today so can someone help me please???P.S PLZ HURRY!!!!1. How do you subtract an integer from another integer without using a number line?2. Rewrite each following subtraction problems as addition problems1) 5-11 2) 15- 213) 0-(-5) 4) 19-(-19)5)-3-(-5) 6)-87-(-87)7)-17-13. When Tom found the difference -11-(-4), he got -15. What might Tom have done wrong?4. When you subtract one negative integer from another, will you answer be greater than or less than the integer you started with? Explain your reasoning and give an example.5. Theo had a balance of -$4 in his savings account. After making a deposit, he has $25 in his account. What is the overall change to his account? Show all your steps. "But Robin Hood lay hidden in Sherwood Forest for one year, and in that time there gathered around him many others like himself, cast out from other folk for this cause and for that. Some had shot deer in hungry wintertime, when they could get no other food, and had been seen in the act by the foresters, but had escaped, thus saving their ears; some had been turned out of their inheritance, that their farms might be added to the King's lands in Sherwood Forest . . . all, for one cause or another, had come to Sherwood to escape wrong and oppression." The Merry Adventures of Robin Hood, Howard Pyle Use the drop-down menus to answer the questions. What happened as a result of Robin's conflict with the man in the forest? ANSWER: He became a leader of a band of outlawsWhat do all the outlaws in Sherwood Forest have in common? ANSWER: They are troubled by unfair laws Which statement best describes how entrepreneurship affects a society'seconomy?A. It encourages people to take risks to create new products.B. It organizes the people who help a business operate.C. It provides the raw materials needed to produce goods.D. It supplies businesses with the tools they need to function. What do people do when they are involved in affective conflictA- maintain focus on their job at handB- allow compromise C- learn new ideas from each other D- focus on their emotional responses Which two important goals did Congress achieve, based on the authority provided by the Articles of Confederation? someone answer these 2 for me What are 3 metaphors found in "The Most Dangerous Game" X-4>3Hellllp me please Please help meAn equation that has no solution is known as:(1) impossible(2) inconsistent(3) incomplete(4) an identity 3 new tires for $210; 4 new tires for $250 Thomas Jefferson and other American leaders were influenced by the Enlightenment ideas.TrueFalse Which one do not lie!!!!!! no sepno sepno sep no sep no sep The_____ side of a sand dune is the side without wind.O deflationslip faceOwindwardOshear A bag contains 120 marbles. Some are red the rest are black. There are 19 red marbles for every black marble. How many red marbles are in the bag? Find the LCM (least common multiple) of 15 and 8.LCM = Steam Workshop Downloader