You have to make 500 mL of a 1.50 M BaCl2. You have 2.0 M barium chloride solution available. Determine how to make the needed dilution

Answers

Answer 1

Answer:

You need 375 mL of BaCl2 solution.

Explanation:

M1V1=M2V2

Dilution formula. Substitute known values and solve for V1.

M1 = 2.0 M

M2 = 1.50 M

V2 = 500 mL

(2.0 M)(V1) = (1.50 M)(500 mL)

V1 = (1.50 M)(500 mL) / (2.0 M)

V1 = 375 mL


Related Questions

A student failed to carry out all of the procedural steps when doing this experiment. Would the following procedural variations result in an experimentally determined mole ratio of water to salt ? Would it be too low, too high or unaffected? a) the student did not use a dry beaker when obtaining the stock solution b) the student used a wet cuvette when determining the concentration of solution of unknown hydrate c) the student used the wrong wavelength, 430nm, during the measurement of the absorbance of unknown hydrate solution

Answers

The procedural variations described would affect the experimentally determined mole ratio of water to salt. Using a wet beaker would likely result in a lower mole ratio, using a wet cuvette would likely result in a higher mole ratio, and using the wrong wavelength would likely have an unknown effect on the mole ratio.

The procedural variations described would impact the accuracy of the experimentally determined mole ratio of water to salt in different ways.

a) If the student did not use a dry beaker when obtaining the stock solution, it would introduce additional water into the solution, leading to a higher total volume and a lower concentration of the salt. As a result, the mole ratio of water to salt would likely be lower than the actual value.

b) If the student used a wet cuvette when determining the concentration of the solution of unknown hydrate, it would introduce extra water into the solution, causing the recorded absorbance to be higher than it should be. This would lead to an overestimation of the concentration of the hydrate and a higher mole ratio of water to salt.

c) Using the wrong wavelength, 430nm, during the measurement of the absorbance of the unknown hydrate solution can have an unknown effect on the mole ratio. The absorption characteristics of the hydrate may not be accurately captured at this wavelength, leading to an unreliable measurement of absorbance and potentially affecting the calculated mole ratio.

In conclusion, these procedural variations would likely impact the experimentally determined mole ratio of water to salt. Using a wet beaker and wet cuvette would likely result in a lower and higher mole ratio, respectively. Using the wrong wavelength could have an unpredictable effect on the mole ratio, depending on the absorption characteristics of the unknown hydrate at that wavelength.

Learn more about  wavelength here: https://brainly.com/question/29398067

#SPJ11

what si the ratio of glyceraldehyde-3-phosphate gap to dihydroxyacetone phosphate

Answers

Glyceraldehyde-3-phosphate (GAP) and dihydroxyacetone phosphate (DHAP) are two isomers of the glycolytic intermediate in cells. The ratio of GAP to DHAP is 1:1 at equilibrium conditions, but it varies significantly under nonequilibrium conditions, such as in the presence of enzymes.

Under such conditions, the GAP to DHAP dihydroxyacetone phosphate ratio can vary between 3:1 and 20:1.The two molecules, GAP and DHAP, interconvert rapidly, and thus, they exist in a rapid equilibrium in cells. In cells, DHAP is an intermediate in glycolysis, and it is converted to GAP by the enzyme triose phosphate isomerase (TPI). The interconversion of GAP to DHAP by TPI is a reversible reaction and is known to be near-equilibrium. However, in glycolysis, the DHAP is typically rapidly utilized by an enzyme called aldolase, such that the DHAP concentration remains low relative to the GAP concentration, which accumulates. Therefore, the ratio of [GAP]:[DHAP] is typically greater than 1:1 under nonequilibrium conditions.Glyceraldehyde-3-phosphate (GAP) and dihydroxyacetone phosphate (DHAP) are two isomers of the glycolytic intermediate in cells. The ratio of GAP to DHAP is 1:1 at equilibrium conditions, but it varies significantly under nonequilibrium conditions, such as in the presence of enzymes. Under such conditions, the GAP to DHAP ratio can vary between 3:1 and 20:1.The two molecules, GAP and DHAP, interconvert rapidly, and thus, they exist in a rapid equilibrium in cells. In cells, DHAP is an intermediate in glycolysis, and it is converted to GAP by the enzyme triose phosphate isomerase (TPI). The interconversion of GAP to DHAP by TPI is a reversible reaction and is known to be near-equilibrium. However, in glycolysis, the DHAP is typically rapidly utilized by an enzyme called aldolase, such that the DHAP concentration remains low relative to the GAP concentration, which accumulates. Therefore, the ratio of [GAP]:[DHAP] is typically greater than 1:1 under nonequilibrium conditions.

learn more about dihydroxyacetone phosphate Refer: https://brainly.com/question/13077675

#SPJ11

complete question: What is the ratio of glyceraldehyde-3-phosphate (GAP) to dihydroxyacetone phosphate (DHAP) in cells at 37 ∘ C under nonequilibrium conditions? [GAP]:[DHAP]= __:1

What is the activation energy of 2N2O(g) ---> 2N2(g) + O2(g)? Rate constant: 0.38 s^-1 at 1000 K and 0.87 s^-1 at 1030 K, First order reaction.

Answers

The activation energy of the reaction 2N2O(g) → 2N2(g) + O2(g) is approximately 106 kJ/mol.

To determine the activation energy (Ea) of a reaction, we can use the Arrhenius equation, which relates the rate constant (k) to temperature (T) and the activation energy:

k = A * exp(-Ea / (R * T))

Where:

k = rate constant

A = pre-exponential factor

Ea = activation energy

R = gas constant (8.314 J/(mol·K))

T = temperature in Kelvin

Rate constant at 1000 K (k1) = 0.38 s^-1

Rate constant at 1030 K (k2) = 0.87 s^-1

To find the activation energy, we can take the ratio of the rate constants at two different temperatures and solve for Ea:

k2 / k1 = (A * exp(-Ea / (R * T2))) / (A * exp(-Ea / (R * T1)))

Cancelling out the pre-exponential factor (A) and rearranging the equation:

k2 / k1 = exp((-Ea / (R * T2)) + (Ea / (R * T1)))

Taking the natural logarithm of both sides:

ln(k2 / k1) = -Ea / (R * T2) + Ea / (R * T1)

Rearranging the equation to solve for Ea:

Ea = R * ((1 / T1) - (1 / T2)) / (ln(k2 / k1))

Substituting the given values:

Ea = (8.314 J/(mol·K)) * ((1 / 1000 K) - (1 / 1030 K)) / (ln(0.87 / 0.38))

Converting the units of the gas constant to kJ/mol·K:

Ea ≈ (8.314 × 10^(-3) kJ/(mol·K)) * ((1 / 1000 K) - (1 / 1030 K)) / (ln(0.87 / 0.38))

Calculating the expression:

Ea ≈ 106 kJ/mol

The activation energy of the reaction 2N2O(g) → 2N2(g) + O2(g) is approximately 106 kJ/mol.

To know more about activation , visit:

https://brainly.com/question/1380484

#SPJ11

use the activity series of metals to predict the products of the following single-replacement reaction.
NiCl2 + Fe
explain your answer

Answers

The reaction between NiCl2 and Fe is a single replacement reaction. A single replacement reaction involves an element reacting with a compound to produce a new element and a new compound. This reaction follows the general equation; A + BC → AC + B.

The activity series of metals will be used to predict the products of a single-replacement reaction when NiCl2 reacts with Fe. Here are the steps involved in predicting the products of a single-replacement reaction; Steps to predicting the product of a single-replacement reaction: Identify the metal that is being displaced. Metals on the left of the activity series of metals are known to displace metals on the right of the series. This is because metals on the left are more active than those on the right.Look for the element that is being displaced. Fe is being displaced since Ni is higher than Fe in the activity series of metals. As a result, Fe will be replaced by Ni. Identify the product. The Ni metal and Fe2+ will be produced by the reaction.

NiCl2(aq) + Fe(s) → Ni(s) + FeCl2(aq)

The balanced chemical equation will be

NiCl2 + Fe → FeCl2 + Ni

The reaction between NiCl2 and Fe is a single replacement reaction. A single replacement reaction involves an element reacting with a compound to produce a new element and a new compound. This reaction follows the general equation; A + BC → AC + B.

To know more about replacement reaction visit:

https://brainly.com/question/15995721

#SPJ11

which class of amines can form intermolecular hydrogen bonds?

Answers

Primary and secondary amines can form intermolecular hydrogen bonds.

How do primary and secondary amines participate in intermolecular hydrogen bonding?

Primary and secondary amines, which are a class of organic compounds, can participate in intermolecular hydrogen bonding. Intermolecular hydrogen bonding occurs when the hydrogen atom attached to the nitrogen atom in the amine molecule forms a hydrogen bond with another electronegative atom, such as oxygen or nitrogen, in a neighboring molecule.

Intermolecular hydrogen bonding is a type of attractive force between molecules and plays a crucial role in various chemical and physical properties. In the case of primary and secondary amines, the presence of a hydrogen atom bonded directly to the nitrogen atom allows for the formation of hydrogen bonds with other molecules. These hydrogen bonds enhance the intermolecular forces between the amines, leading to higher boiling points and increased solubility in polar solvents.

The ability of primary and secondary amines to form intermolecular hydrogen bonds is significant in biological systems and organic chemistry reactions. It influences molecular interactions, stability, and the behavior of compounds containing amine functional groups.

Learn more about hydrogen bonding

brainly.com/question/31139478

#SPJ11

for the reaction: agi(s) br2(g) → agbr(s) i2(s) δh° = –54.0 kj δhf° for agbr(s) = –100.4 kj/mol δhf° for br2(g) = 30.9 kj/mol the value of δhf° for agi(s) is: group of answer choices

Answers

The value of ΔHf° for AgI(s) is 13.1 kJ/mol.

Hess's law states that the enthalpy change of a reaction is independent of the route taken provided that the initial and final conditions are the same. For example, the heat energy that flows when calcium oxide (quicklime) reacts with water to produce calcium hydroxide (slaked lime) is the same whether we proceed directly or indirectly.

The standard enthalpy of formation, also known as ΔHf°, is the amount of heat absorbed or released when one mole of a substance is created from its constituent elements in their standard states.

This means that all reactants and products must be in their standard states at the time of the reaction.The standard enthalpy of formation of AgBr(s) is -100.4 kJ/mol, while that of Br2(g) is 30.9 kJ/mol.

The reaction is written as follows:Agi(s) + Br₂(g) → AgBr(s) I2(s) δH° = -54.0 kJ

Let's start with Hess's Law:ΔHf° of AgBr(s) + ΔHf° of I2(s) → ΔHf° of AgI(s) + ΔH° 1

We'll need to change the sign of ΔHf° for AgBr(s) because it is on the product side:

ΔHf° of AgI(s) = ΔHf° of AgBr(s) + ΔHf° of I2(s) + ΔH° 1

Inserting the data from the issue:ΔHf° of AgI(s) = -100.4 kJ/mol + 13.1 kJ/mol - (-54.0 kJ/mol)ΔHf° of AgI(s) = 13.1 kJ/mol + 45.6 kJ/mol

ΔHf° of AgI(s) = 58.7 kJ/mol or 59 kJ/mol rounded off to one significant figure.

To know more about Hess's law click on below link:

https://brainly.com/question/10504932#

#SPJ11

the equilibrium constant for the following reaction is 1.5×108 at 25∘c . n2(g) 3h2(g)⇌2nh3(g) the value of δg∘ for this reaction is ________ kj/mol

Answers

The calculated value of ΔG° for this reaction is -31.4 kJ/mol which is the answer obtained after calculation.   The value of ΔG° for the reaction N2(g) + 3H2(g) ⇌ 2NH3(g) can be calculated using the equation ΔG° = -RT ln(K), where R is the gas constant and T is the temperature in Kelvin. Given that the equilibrium constant (K) is 1.5 × 10^8 at 25°C, the value of ΔG° can be determined by plugging in the values into the equation and solving for ΔG°.

The equilibrium constant (K) for a reaction relates to the concentrations of the reactants and products at equilibrium. In this case, the equilibrium constant is given as 1.5 × 10^8. The value of ΔG°, the standard Gibbs free energy change, can be calculated using the equation ΔG° = -RT ln(K), where R is the gas constant (8.314 J/(mol·K) or 0.008314 kJ/(mol·K)) and T is the temperature in Kelvin. To calculate ΔG°, we first need to convert the temperature from Celsius to Kelvin by adding 273.15. Thus, 25°C = 298.15 K. Now we can substitute the values into the equation:

ΔG° = -RT ln(K)

= -(0.008314 kJ/(mol·K) × 298.15 K) ln(1.5 × 10^8)

Using a calculator or computer program to evaluate the natural logarithm and perform the multiplication, the calculated value of ΔG° is approximately -31.4 kJ/mol. The negative sign indicates that the reaction is exergonic, meaning it releases energy. In this case, the value of ΔG° indicates that the forward reaction (N2 + 3H2 → 2NH3) is favoured at standard conditions (1 atm pressure and 25°C).

To learn more about equilibrium constant, click here: brainly.com/question/31482445

#SPJ11

A 0.72 g sample of polyvinyl chloride (PVC) is dissolved in 250.0 mL of a suitable solvent at 25 °C. The solution has an osmotic pressure of 1.67mmHg. What is the molar mass of the PVC? 6.4 x 109 g/mol 3.2 x 109 g/mol 1.6 x 109 g/mol 3.2 x 10 g/mol 6.4 x 10' g/mol

Answers

The molar mass of PVC is 3.2 x 10⁵ g/mol.

To solve this problem, we can use the following formula:

π = MRT

where π is the osmotic pressure, M is the molar concentration of the solute, R is the gas constant (0.08206 L atm K^-1 mol^-1), and T is the temperature in Kelvin.

First, we need to calculate the molar concentration of PVC:

n = m/M

where n is the number of moles of PVC, m is the mass of PVC (0.72 g), and M is the molar mass of PVC.

Rearranging this equation gives:

M = m/n

We can then substitute this expression for M into the formula for osmotic pressure:

π = (m/n)RT

Solving for M gives:

M = (mRT)/πn

Substituting in the given values:

m = 0.72 g V = 250.0 mL = 0.25 L T = 25 °C + 273.15 = 298.15 K π = 1.67 mmHg = 0.0022 atm

We can convert the volume to liters:

V = 0.25 L

We can also convert the pressure to atm:

π = 0.0022 atm

Finally, we need to calculate the number of moles of PVC:

n = m/M

We can rearrange this equation to solve for M:

M = m/n

Substituting in the given values:

m = 0.72 g n = m/M

We can then substitute these expressions for m and n into our equation for M:

M = (mRT)/πn

Solving for M gives:

M ≈ 3.2 x 10⁵ g/mol

To know more about molar mass

https://brainly.com/question/837939

#SPJ11

Which pairs are isomers? CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3. CH3CH(CH3)CH2CH2CH2CH2CH2CH2CH3 and CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3. CH3CH2CH2CH2CH2CH3 and CH3CH2CH(CH3)CH2CH2CH3. CH3CH(CH3)CH2CH2CH(CH3)CH3 and CH3CH2CH2CH2CH2CH2CH2CH3. CH3CH(CH3)CH2CH3 and CH3CH2CH2CH2CH3

Answers

The pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.

Isomers are the molecules which have the same molecular formula but differ in the arrangement of their atoms. The following pairs of compounds are isomers: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3.CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3.CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.In the first pair of compounds, the molecule on the left is n-butane, while the molecule on the right is 2-methylpropane or isobutane. They are isomers because both have the same molecular formula C4H10, but different structures.2. In the second pair of compounds, the molecule on the left is octane, while the molecule on the right is 2-methylheptane.

These compounds have the same molecular formula, C8H18, but different structures.3. In the third pair of compounds, the molecule on the left is 2-methylpentane, while the molecule on the right is 3-methylpentane.

They are isomers because they have the same molecular formula C6H14, but different structures.4.

In the fourth pair of compounds, the molecule on the left is 2,3-dimethylbutane, while the molecule on the right is 2,4-dimethylpentane.

They are isomers because they have the same molecular formula C8H18, but different structures.5. In the fifth pair of compounds, the molecule on the left is isopropyl group, while the molecule on the right is n-propyl group.

They are isomers because they have the same molecular formula C3H7, but different structures.

In conclusion, the pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.

To know more about isomers visit:

brainly.com/question/32508297

#SPJ11

Why do we measure resistivity instead of resistance to verify metal deposition (for thermal evaporation)?

Answers

Measuring resistivity provides a standardized and comparable value for different samples and materials, enabling better comparisons and analysis of the deposited metal layers.

We measure resistivity instead of resistance to verify metal deposition during thermal evaporation because resistivity is a material property that provides a more accurate and reliable measurement of the electrical conductivity of a material, including thin films or coatings.

Resistance (R) is a measure of how much a material opposes the flow of electric current and is influenced by both the resistivity (ρ) of the material and its dimensions (length and cross-sectional area) according to the formula R = ρ × (L/A), where L is the length and A is the cross-sectional area.

When measuring resistance alone, it can be challenging to isolate the contribution of the deposited metal layer from other factors such as the substrate's resistance or the contact resistance at the interfaces. These additional resistances can affect the overall measured resistance and make it difficult to accurately determine the characteristics of the deposited metal layer.

On the other hand, resistivity is an intrinsic property of a material that depends only on its composition and temperature. By measuring the resistivity (ρ) of the deposited metal layer, we can eliminate the influence of substrate resistance and contact resistances. This allows us to obtain a more precise measurement of the electrical conductivity and quality of the metal deposition process.

Learn more about Resistivity from the link given below.

https://brainly.com/question/29427458

#SPJ4

Schrödinger Equation and the Particle in a Box
Combine your answers from Parts A and B. Find the expression for the left side of the Schrödinger equation valid on the interval 0?x?L.
Express your answer in terms of ?, m, n, x, L, and C as needed.
??22md2dx2?n(x)+U(x)?n(x) =

Answers

The expression for the left side of the Schrödinger equation, valid on the interval 0 ≤ x ≤ L, is: -((h^2)/(8π^2m)) * (d^2ψ_n(x)/dx^2) + U(x) * ψ_n(x) = E_n * ψ_n(x)

The Schrödinger equation describes the behavior of a quantum particle in terms of its wave function ψ(x). In the context of the Particle in a Box, the wave function represents the probability amplitude of finding the particle at a particular position (x) within the box.

The left side of the Schrödinger equation consists of two terms: the kinetic energy term and the potential energy term.

Kinetic Energy Term:

The kinetic energy term represents the particle's kinetic energy operator. In one dimension, it is given by -(h^2/(8π^2m)) * (d^2ψ_n(x)/dx^2), where h is the Planck's constant, m is the mass of the particle, and ψ_n(x) is the wave function corresponding to the nth energy level.

Potential Energy Term:

The potential energy term, U(x), represents the potential energy function of the particle within the box. It depends on the specific conditions of the system.

Right Side:

The right side of the Schrödinger equation represents the total energy of the particle, E_n, multiplied by the wave function ψ_n(x). E_n is quantized and corresponds to the energy eigenvalue associated with the nth energy level.

The expression -(h^2/(8π^2m)) * (d^2ψ_n(x)/dx^2) + U(x) * ψ_n(x) = E_n * ψ_n(x) represents the left side of the Schrödinger equation for the Particle in a Box system, valid on the interval 0 ≤ x ≤ L. It combines the kinetic energy and potential energy terms, with the right side representing the total energy of the particle.

To know more about Schrödinger, visit:

https://brainly.in/question/10303664

#SPJ11

In the nuclear transmutation represented by Pu(He,n), what is the product? A. uranium-242 B. curium-245 C. curium-242 D. uranium-245 E. uranium-243

Answers

Pu(He,n) represents a nuclear transmutation, which is a nuclear reaction in which an atomic nucleus is transformed into another element or a different isotope of the same element.

In this reaction, a helium nucleus (He) is bombarded at the nucleus of plutonium-239 (Pu), leading to the formation of a new element.The product formed from the nuclear transmutation represented by Pu(He,n) is curium-242. Therefore, the correct option is C.The reaction can be represented as follows:$$\ce{^{239}_{94}Pu + ^4_2He -> ^{242}_{96}Cm + n}$$The symbol n represents a neutron, which is also produced in this reaction. Curium-242 is a radioactive isotope of curium, a synthetic element that was first produced in 1944 by Glenn T. Seaborg, Ralph A. James, and Albert Ghiorso at the University of California, Berkeley.

Learn more about nuclear transmutation here:

https://brainly.com/question/30078683

#SPJ11

what is the value of a preferred stock when the dividend rate is percent on a par value? the appropriate discount rate for a stock of this risk level is percent.

Answers

The value of the preferred stock is $80.

The value of a preferred stock when the dividend rate is percent on a par value, and the appropriate discount rate for a stock of this risk level is percent can be calculated using the formula:

Value of Preferred Stock = Dividend Payment / Discount Rate

Where Dividend Payment = Dividend Rate x Par Value

Therefore, the value of the preferred stock can be calculated as:

Value of Preferred Stock = (Dividend Rate x Par Value) / Discount Rate

In the formula, dividend rate refers to the rate of return that an investor earns on their investment in a preferred stock. The par value is the face value of the stock, which is usually set at $100 or $1,000 per share. The discount rate is the rate of return required by investors to invest in a stock of this risk level.

For example, if the dividend rate is 8% and the par value is $100, the dividend payment would be $8. If the appropriate discount rate for a stock of this risk level is 10%, the value of the preferred stock would be calculated as follows:

Value of Preferred Stock = ($8 / 10%) = $80

To know more about rate of return  click on below link:

https://brainly.com/question/17164328#

#SPJ11

a compound is composed of two elements x and y and has the formula xayb where a and b are whole numbers. the compound is composed of .8313 g of elemnt x and .2743 g of element Y. The molar mass of element X is 63.5 g/mol. The molar mass of element Y is 16.0 g/mol. Determine the value of the subscripts A and B for this compound. A= B=

Answers

The values of the subscripts A and B for the compound xayb are A = 3 and B = 4.

To determine the values of the subscripts A and B for the compound xayb, we need to calculate the number of moles of elements X and Y based on their given masses and molar masses.

Given:

Mass of element X (mX) = 0.8313 g

Mass of element Y (mY) = 0.2743 g

Molar mass of element X (MX) = 63.5 g/mol

Molar mass of element Y (MY) = 16.0 g/mol

To find the number of moles, we'll use the formula:

Number of moles (n) = Mass / Molar mass

Number of moles of element X:

nX = mX / MX

nX = 0.8313 g / 63.5 g/mol

nX = 0.01308 mol

Number of moles of element Y:

nY = mY / MY

nY = 0.2743 g / 16.0 g/mol

nY = 0.01714 mol

Now, we'll find the ratio of the moles of elements X and Y to determine the subscripts A and B.

Ratio of moles: nX/nY = A/B

Substituting the values:

0.01308 mol / 0.01714 mol = A / B

Simplifying the ratio:

A/B ≈ 0.763

Since A and B must be whole numbers, we can approximate the ratio to the nearest whole numbers:

A = 3

B = 4

Therefore, the values of the subscripts A and B for the compound xayb are A = 3 and B = 4.

To know more about compound

https://brainly.com/question/14117795

#SPJ4

In a sealed and rigid container, a sample of gas at 4.40 atm and 60.0
°C is cooled to 20.0 °C. What is the pressure (in atm) of the gas at
20.0 °C?

Answers

Explanation:

To find the pressure of the gas at 20.0 °C, we can use the combined gas law, which states:

(P1 * V1) / (T1) = (P2 * V2) / (T2)

Where:

P1 = Initial pressure

V1 = Initial volume

T1 = Initial temperature

P2 = Final pressure (what we're trying to find)

V2 = Final volume (assuming the volume remains constant)

T2 = Final temperature

Given:

P1 = 4.40 atm

T1 = 60.0 °C = 333.15 K (converting to Kelvin)

T2 = 20.0 °C = 293.15 K (converting to Kelvin)

Since the volume is assumed to remain constant (rigid container), we can simplify the equation as follows:

P1 / T1 = P2 / T2

Now, we can substitute the given values and solve for P2:

(4.40 atm) / (333.15 K) = P2 / (293.15 K)

Cross-multiplying:

P2 = (4.40 atm) * (293.15 K) / (333.15 K)

≈ 3.874 atm

Therefore, the pressure of the gas at 20.0 °C is approximately 3.874 atm.

consider the reaction 2c(graphite) h2(g) ⇄ c2h2 (g) δg° = 209.2 kj at 25 °c. calculate δg at 25°c for the reaction when p(h2) = 100 atm and p(c2h2) = 0.10 atm.

Answers

209.2 is  δg at 25°c fοr the reactiοn when p(H₂) = 100 atm and p(C₂H₂) = 0.10 atm.

Graphite is a substance οf what kind?

An οrganic mineral that is derived frοm carbοn is called graphite. It is a naturally οccurring element that is frequently prοduced by sedimentary carbοn cοmpοunds, but it can alsο be fοund in magma, certain rοcks that cοntain οrganic carbοn, and as a byprοduct οf the reductiοn οf sedimentary carbοn thrοugh the reductiοn οf carbοnates.

A thermοdynamic system's enthalpy, which is οne οf its prοperties, is calculated by multiplying the vοlume and pressure οf the system by their cοmbined pressure and vοlume. It is a state functiοn that is frequently emplοyed in measurements οf chemical, biοlοgical, and physical systems at cοnstant pressure, which is cοnveniently prοvided by the substantial ambient envirοnment.

2C + H₂-> C₂H₂

(ΔH) reactiοn = (ΔH) prοduct - (ΔH) reactants

(ΔH) reactiοn = (ΔH) C₂H₂- ((ΔH) C + (ΔH) H₂)

(ΔH) C and (ΔH) H₂have zerο value as fοr free element, (ΔH) is  zerο

Frοm the available data: Hf (kJ / mοl) C₂ H₂(g)=  209.2

(ΔH) reactiοn = ΔH) C₂H₂ - ((ΔH) C + (ΔH) H₂)

(ΔH) reactiοn = 209.2 - (0 + 0) = 209.2

To learn more about enthalpy :

https://brainly.com/question/30431725

#SPJ4

1. What precautions should you take when working with: (a) ethyl ether? (b) 25% sodium methoxide in methanol? 2. What is the purpose of the toluene in the reaction for forming the ethylene ketal in Synthesis 3? 3. Calculate the theoretical yield for each of the three syntheses. Use the amount of starting material listed in the Reagents and Properties table for each synthesis; that is, aldol condensation product from p-anisaldehyde, Michael addition product from aldol condensation product, and ethylene ketal product from Michael addition product. [Note: Determine the limit-ing reagent in Synthesis 1.] 4. Calculate the overall theoretical yield for the sequence, p-anisaldehyde to the ethylene ketal.

Answers

The theoretical yield = (0.08 mol x 0.08 mol x 0.08 mol) = 0.000512 mol or 0.059 g. The overall theoretical yield of the reaction sequence is 0.059 g.

(a) Precautions while working with ethyl ether: Ethyl ether is an extremely flammable liquid with a low boiling point. Therefore, it should be kept away from heat, sparks, or flames. To reduce the risk of ignition, all electrical equipment should be explosion-proof. To avoid inhalation of the fumes, all operations should be carried out in a well-ventilated location. Wear gloves to avoid skin contact. (b) Precautions while working with 25% sodium methoxide in methanol: Because sodium methoxide is a strong base, it is corrosive. Sodium methoxide should be stored in a well-ventilated area and kept away from moisture and air. Before handling, always wear protective gear such as gloves, goggles, and a lab coat. Ingestion or inhalation of sodium methoxide or its fumes should be avoided.

The purpose of toluene in the reaction of forming the ethylene ketal in Synthesis 3 is to form an azeotrope with water, which helps to eliminate water from the reaction mixture, allowing for the reaction to proceed. Toluene was used in the reaction as an azeotropic distilling solvent to eliminate water, which is produced in the reaction.

Limiting reagent in Synthesis 1: To determine the limiting reagent, we must first identify the reactants' stoichiometry, which is 1:1. As a result, the limiting reagent will be the reactant with the least number of moles.

Theoretical yield for each synthesis:

Synthesis 1: Theoretical yield of aldol condensation product from p-anisaldehyde = (0.08 mol p-anisaldehyde) x (1 mol product/mol p-anisaldehyde) = 0.08 mol productSynthesis 2: Theoretical yield of Michael addition product from aldol condensation product = (0.08 mol aldol condensation product) x (1 mol product/mol aldol condensation product) = 0.08 mol productSynthesis 3: The theoretical yield of the ethylene ketal product from Michael addition product = (0.08 mol Michael addition product) x (1 mol product/mol Michael addition product) = 0.08 mol product.
Overall theoretical yield for the sequence, p-anisaldehyde to the ethylene ketal:
The overall theoretical yield of the reaction sequence is determined by multiplying the theoretical yield of each synthesis.

As a result: Overall theoretical yield = (0.08 mol x 0.08 mol x 0.08 mol) = 0.000512 mol or 0.059 g. Answer: The overall theoretical yield of the reaction sequence is 0.059 g.

know more about  theoretical yield

https://brainly.com/question/14966377

#SPJ11

.An ideal gas in a sealed piston is allowed to expand isothermally and reversibly against an external pressure of 1.0 atm. What can be said of the change in the entropy of the surroundings, ΔSsurr, for this process?
a) ΔSsurr > 0
b) ΔSsurr = 0
c) ΔSsurr < 0

Answers

since the process is reversible, we can determine the change in the entropy of the gas using the ideal gas law, PV = nRT, and the equation ΔS = nR ln (Vf/Vi). It can be observed that ΔSgas > 0, since the volume increases, while the temperature remains constant. Therefore, the total entropy change, ΔStotal = ΔSgas + ΔSsurr, is greater than zero. a) ΔSsurr > 0.

An ideal gas in a sealed piston is allowed to expand isothermally and reversibly against an external pressure of 1.0 atm. The ideal gas in a sealed piston is allowed to expand isothermally and reversibly against an external pressure of 1.0 atm, and we are required to identify the change in the entropy of the surroundings, ΔSsurr, for this process. ΔSsurr will be greater than zero. This is because, during an isothermal expansion process, the external pressure is lower than the pressure of the gas inside the container. As a result, the gas expands, doing work on the surroundings. Work is done by the gas, but the heat is transferred to and from the surroundings.

The magnitude of the heat transferred to the surroundings is equal to the magnitude of the work done by the gas, and the sign of the work done is negative because the gas expands and performs work on the surroundings. As a result, the heat transferred to the surroundings is positive, indicating that the entropy of the surroundings increases, which implies that ΔSsurr is greater than zero.

In addition, since the process is reversible, we can determine the change in the entropy of the gas using the ideal gas law, PV = nRT, and the equation ΔS = nR ln (Vf/Vi). It can be observed that ΔSgas > 0, since the volume increases, while the temperature remains constant. Therefore, the total entropy change, ΔStotal = ΔSgas + ΔSsurr, is greater than zero. a) ΔSsurr > 0.

know more about entropy

https://brainly.com/question/32167470

#SPJ11

What would happen to the average kinetic energy of the molecules of a gas sample if the temperature of the sample increased from 20°C to 40°C? would increase O It would decrease O It would double O It would become half its value

Answers

If the temperature of a gas sample increases from 20°C to 40°C, the average kinetic energy of the gas molecules would increase.

Generally, according to the kinetic theory of gases, the average kinetic energy of gas molecules is always directly proportional to the temperature of the gas. The relationship for the above is given by the equation:

Average kinetic energy = (3/2) × k × T

In this equation k represents the Boltzmann constant and T is the absolute temperature.

Since the given scenario involves an increase in temperature, the average kinetic energy of the gas molecules would also increase. The exact amount of increase can be calculated using the equation above, but it is important to note that the average kinetic energy would not double or become half its value unless the temperature were to change by a factor of two.

Learn more about kinetic energy from the link given below.

https://brainly.com/question/999862

#SPJ4

Choose reagents from the table for conversion of 1-butanol to the following substances. Use letters from the table to list reagents in the order used (first at the left). Example: ab Reagents a. NaN3 c. CrO3/H3O+ c. Dess-Martin peropdinane in CH2Cl2 d. Butylamine e. excess NH3
f. SOCl2 g. PBr3 h. Br2/NaOH, H2O i. LiAlH4 H2O j. H2/Ni, i-PrNH2 k. NaBH3CN, (CH3)2NH l. Ag2O, H2O, heat m. NaCN n. H2O, heat o. excess CH3l a) pentlylamine: b) dibutylamine:

Answers

To convert 1-butanol to pentlylamine, the reagents used are [tex]NaN_{3}[/tex], [tex]H_{2} O[/tex], and [tex]NH_{3}[/tex] (in excess), while to convert 1-butanol to dibutyl amine, the reagents used are [tex]SOCl_{2}[/tex] and Butylamine.

To convert 1-butanol to pentlylamine, the reagents would be:

a) [tex]NaN_{3}[/tex](Sodium azide) - to perform azide substitution

b) [tex]H_{2} O[/tex]- for hydrolysis of the azide group

c) [tex]NH_{3}[/tex](Ammonia) in excess - to carry out reductive amination

Therefore, the reagents used in the conversion of 1-butanol to pentlylamine would be a) [tex]NaN_{3}[/tex], b) [tex]H_{2} O[/tex], and c) [tex]NH_{3}[/tex](in excess).

To convert 1-butanol to dibutyl amine, the reagents would be:

a) [tex]SOCl_{2}[/tex](Thionyl chloride) - to perform a nucleophilic substitution

b) Butylamine - to react with the chloride group

Therefore, the reagents used in the conversion of 1-butanol to dibutyl amine would be: a) [tex]SOCl_{2}[/tex]and b) Butylamine.

To know more about "sodium azide", refer to the link given below:

https://brainly.com/question/28379904

#SPJ4

(9%) Problem 10: In Bohr's model of a Hyodrogen atom, electrons move in orbits labeled by the quantum number n. Randomized Variables Find the radius, in meters of the orbit of an electron around a Hydrogen atom in the n = 4 state according to Bohr's theory. E sin cos taní) cotan asino acos atan acotan sinho cosho tanho cotanho Degrees O Radians 78 9 456 1 2 3 0 VODARICA + . 0

Answers

According to Bohr's model of the hydrogen atom, the radius of the electron's orbit in the n = 4 state is approximately 8.464 meters.

The radius of the orbit of an electron around a hydrogen atom in the n = 4 state, according to Bohr's model, can be determined using the formula r = (0.529 * n^2) / Z, where r represents the radius, n is the quantum number, and Z is the atomic number of the nucleus (in this case, Z = 1 for hydrogen).

Substituting the values into the formula:

r = (0.529 * 4^2) / 1

r = (0.529 * 16) / 1

r = 8.464 meters

Therefore, the radius of the electron's orbit around a hydrogen atom in the n = 4 state, based on Bohr's theory, is approximately 8.464 meters.

According to Bohr's model of the hydrogen atom, the radius of the electron's orbit in the n = 4 state is approximately 8.464 meters. This model suggests that electrons occupy specific energy levels and move in circular orbits around the nucleus. However, it is important to note that Bohr's model is a simplified representation and has limitations in describing the behavior of electrons in atom.

To know more about Bohr's model visit:

brainly.com/question/11891941

#SPJ11

For an aspirin synthesis experiment. 200 mg of salicylic acid and 2 ml acetic anhydride were added to a 25 ml round bottom flask. 5 mg of starting material was diluted in acetone for spotting onto the TLC plate. The reaction mixture was spotted directly without dilution. The plate developed 10:1 hexanes to ethyl acetate and was visualized with a ultraviolet lamp and stained with Iron (III) chloride (1% in MeOH:H2O). 10 ml of de-ionized water was slowly added to the mixture. An ice bath used for crystals formation. The reaction mixture was poured to a 50 ml Erlenmeyer flask. The product dried as the vacuum was on for 10 minutes and finally analyzed for NMR. Mass of purified aspirin product 1.00 (g)
Please answer the following:
Calculate the % yield of the reaction, clearly showing your work.
Carefully copy your TLC plates into your notebook; and then determine Rf values of the starting
material and product. Never submit the actual TLC plates with your lab report, copy them "to scale".
If the TLC solvent was switched to 1:1 H:E, would you expect the Rf values increase or decrease?
Additionally, draw a figure showing how such a TLC plate might look.
Draw a synthesis of the early analgesic phenacetin that employs acetic anhydride, with mechanism.

Answers

The % yield of the aspirin synthesis reaction can be calculated using the following formula: % Yield = (Actual yield / Theoretical yield) * 100

To determine the actual yield, we are given that the mass of the purified aspirin product is 1.00 g. The theoretical yield can be calculated based on the molar mass of salicylic acid (C7H6O3), which is 138.12 g/mol, and assuming a stoichiometric ratio of 1:1 between salicylic acid and aspirin.

The molar mass of salicylic acid is (7 * 12.01) + (6 * 1.01) + (3 * 16.00) = 138.12 g/mol.

The theoretical yield can be calculated as follows:

Theoretical yield = (Mass of salicylic acid used / Molar mass of salicylic acid) * Molar mass of aspirin

Mass of salicylic acid used = 200 mg = 0.2 g

Theoretical yield = (0.2 g / 138.12 g/mol) * 180.16 g/mol

Now, you can plug in the values and calculate the % yield.

To determine the Rf values of the starting material and product on the TLC plate, you need to measure the distance traveled by each spot (distance from the origin to the center of the spot) and divide it by the distance traveled by the solvent (distance from the origin to the solvent front). This will give you the Rf value for each compound.

Switching the TLC solvent to 1:1 H: E (hexanes: ethyl acetate) would likely increase the Rf values of both the starting material and the product. This is because ethyl acetate is a more polar solvent compared to hexanes, and a more polar solvent tends to increase the mobility of compounds on the TLC plate.

Unfortunately, I am unable to generate a visual representation of the TLC plate or draw the synthesis of phenacetin using acetic anhydride with the mechanism.

Learn more about aspirin synthesis, below:

https://brainly.com/question/31384944

#SPJ11

A 20.0 ml sample of 0.115 M sulfurous acid solution is titrated with 0.1014 M KOH. At what added volume of base solution does each equivalence point occur?

Answers

For the volume of KOH required, we can use its concentration: the volume of KOH = moles of KOH / concentration = 0.0046 moles / 0.1014 M≈ 0.0453 L ≈ 45.3 ml. In this titration, a 20.0 ml sample of 0.115 M sulfurous acid solution is titrated with 0.1014 M KOH.

To determine the volumes at which the equivalence points occur, we need to consider the stoichiometry of the reaction between sulfurous acid (H2SO3) and potassium hydroxide (KOH). Since sulfurous acid is a diprotic acid, it can donate two protons per molecule. The balanced equation for the neutralization reaction is: H2SO3 + 2KOH → K2SO3 + 2H2O. From the balanced equation, we can see that for every 1 mole of sulfurous acid, we need 2 moles of KOH to reach the equivalence point. Given that the initial volume of the sulfurous acid solution is 20.0 ml and the concentration is 0.115 M, we can calculate the initial number of moles of sulfurous acid: moles of H2SO3 = volume (in L) × concentration = 20.0 ml × (1 L/1000 ml) × 0.115 M = 0.0023 moles. Since there is a 1:2 stoichiometric ratio between sulfurous acid and KOH, we need 0.0046 moles of KOH to reach the first equivalence point.

To learn more about titration, click here:

brainly.com/question/31483031

#SPJ11

gold-198 has a half-life of 2.7 days. how much of a 323.7 mg gold-198 sample will remain after 13.5 days?

Answers

To determine the amount of gold-198 remaining after 13.5 days, we can use the formula for radioactive decay:

N(t) = N₀ * (1/2)^(t / T₁/₂)

Where:

N(t) is the amount of gold-198 remaining after time t

N₀ is the initial amount of gold-198

T₁/₂ is the half-life of gold-198

t is the elapsed time

Given that the half-life of gold-198 is 2.7 days, we can substitute the values into the equation:

N(13.5) = 323.7 mg * (1/2)^(13.5 / 2.7)

N(13.5) = 323.7 mg * (1/2)^5

N(13.5) = 323.7 mg * 1/32

N(13.5) = 10.11875 mg

Therefore, approximately 10.12 mg of the gold-198 sample will remain after 13.5 days.

To explain further, after each half-life, the amount of gold-198 is reduced by half. Since 13.5 days is equivalent to 5 half-lives (13.5 / 2.7 = 5), we multiply the initial amount by (1/2)^5 to calculate the remaining amount. This yields a result of 1/32 or approximately 0.03125, which when multiplied by the initial amount of 323.7 mg, gives us 10.12 mg as the remaining quantity.

Learn more about radioactive decay here : brainly.com/question/1770619
#SPJ11

.Consider the titration of 50.0 mL of 0.116 M NaOH with 0.0750 M HCl. Calculate the pH after the addition of each of the following volumes of acid: Part A 5.0 mL Express your answer using four significant figures.

Answers

The pH after adding 5.0 mL of 0.0750 M HCl is approximately 12.994.

To calculate the pH after the addition of 5.0 mL of 0.0750 M HCl, we need to determine the number of moles of HCl added and the resulting concentration of OH- ions in the solution.

Given:

Initial volume of NaOH = 50.0 mL

Initial concentration of NaOH = 0.116 M

Volume of HCl added = 5.0 mL

Concentration of HCl = 0.0750 M

First, we need to determine the moles of HCl added:

Moles of HCl = Volume of HCl added * Concentration of HCl

Moles of HCl = 5.0 mL * 0.0750 M = 0.375 mmol

Since HCl is a strong acid and NaOH is a strong base, they react in a 1:1 stoichiometric ratio. Therefore, the moles of OH- ions neutralized by the added HCl is also 0.375 mmol.

Now, we calculate the moles of OH- ions remaining from the initial NaOH solution:

Moles of NaOH = Initial volume of NaOH * Initial concentration of NaOH

Moles of NaOH = 50.0 mL * 0.116 M = 5.8 mmol

Moles of OH- remaining = Moles of NaOH - Moles of OH- neutralized

Moles of OH- remaining = 5.8 mmol - 0.375 mmol = 5.425 mmol

Next, we calculate the concentration of OH- ions in the solution:

OH- concentration = Moles of OH- remaining / Total volume of solution

Total volume of solution = Initial volume of NaOH + Volume of HCl added

Total volume of solution = 50.0 mL + 5.0 mL = 55.0 mL = 0.055 L

OH- concentration = 5.425 mmol / 0.055 L = 98.64 mM

Finally, we can calculate the pOH and pH of the solution:

pOH = -log10(OH- concentration)

[tex]pOH = -log10(98.64 x 10^-3) =1.006[/tex]

pH = 14 - pOH

pH = 14 - 1.006 ≈ 12.994

Therefore, the pH after the addition of 5.0 mL of 0.0750 M HCl is approximately 12.994.

Learn more about the pH here:

https://brainly.com/question/12609985

#SPJ4

which of the following produces the value for r2, which is used as a measure of effect size in an independent measures t-test?

Answers

The value of r² is not used as a measure of effect size in an independent measures t-test. Instead, Cohen's d is used as a measure of effect size.

R² is generally used to measure the goodness of fit of a regression model.In an independent measures t-test, Cohen's d is used to determine the size of the difference between the means of two groups.

It is a standardized measure of the difference between the means of two groups, taking into account the variability of the data within each group.

Cohen's d is calculated by subtracting the mean of one group from the mean of the other group, and dividing that difference by the pooled standard deviation of both groups. A larger value of Cohen's d indicates a larger effect size, while a smaller value indicates a smaller effect size.

To know more about t-test refer here: https://brainly.com/question/1189751#

#SPJ11

Using the Arrhenius concept of acids and bases, identify the Arrhenius acid and base in each of the following reactions:
KOH(aq)+HNO3(aq)?KNO3(aq)+H2O(l)
(CH3)3N(g)+HI(g)?(CH3)3NHI(s)
Drag the appropriate items to their respective bins.

Answers

Arrhenius concept of acids and basesThe Arrhenius concept of acids and bases states that acids are substances that dissolve in water and produce hydrogen ions (H+) and bases are substances that dissolve in water and produce hydroxide ions (OH-).

Arrhenius acids and bases react with one another to form a salt and water as seen in the following equations:Base + Acid → Salt + WaterAccording to the Arrhenius concept of acids and bases, KOH is a base and HNO3 is an acid because KOH produces hydroxide ions (OH-) when it dissolves in water, and HNO3 produces hydrogen ions (H+) when it dissolves in water.KOH(aq) + HNO3(aq) → KNO3(aq) + H2O(l)According to the Arrhenius concept of acids and bases, (CH3)3N is a base, and HI is an acid because (CH3)3N produces hydroxide ions (OH-) when it dissolves in water, and HI produces hydrogen ions (H+) when it dissolves in water.(CH3)3N(g) + HI(g) → (CH3)3NHI(s)

To know more about  Arrhenius visit:

https://brainly.com/question/13603126

#SPJ11

When solid zinc is added to hydrochloric acid, the products are hydrogen gas and an aqueeous solution of zinc chloride. You could feel the test tube get hot. Sketch the energy graph that represents the chemical energy within this reaction. In addition, state whether this reaction is endothermic or exothermic.

Answers

The energy graph for the reaction between solid zinc and hydrochloric acid would show a decrease in energy as the reaction proceeds. This reaction is exothermic, releasing energy in the form of heat.

When solid zinc (Zn) is added to hydrochloric acid (HCl), a redox reaction takes place. The zinc atoms lose electrons, oxidizing to Zn2+ ions, while the hydrogen ions from the acid gain electrons, reducing to form hydrogen gas (H2). The reaction can be represented by the following equation:

[tex]Zn(s) + 2HCl(aq) - > ZnCl_2(aq) + H_2(g)[/tex]

The energy graph for this reaction would show a decrease in energy as the reaction proceeds from the reactants (solid zinc and hydrochloric acid) to the products (aqueous zinc chloride and hydrogen gas). This decrease in energy represents the release of energy during the reaction.

The fact that you could feel the test tube getting hot indicates that the reaction is exothermic. Exothermic reactions release energy in the form of heat, resulting in an increase in temperature. In this case, the heat is generated as a result of the chemical reaction between zinc and hydrochloric acid, indicating that the reaction is exothermic.

Learn more about exothermic here:

https://brainly.com/question/4345448

#SPJ11

calculate the equilibrium constant at 25°c from the free-energy change for the following reaction: substance (kj/mol) 65.52 –147.0 –78.87 77.12 (enter your answer to two significant figures.)

Answers

The equilibrium constant (K) at 25°C, based on the given free-energy change, is approximately 9.74.

To calculate the equilibrium constant (K) at 25°C from the free-energy change (ΔG) for a reaction, we can use the equation:

ΔG = -RT ln(K)

Where; ΔG is the free-energy change

R is the gas constant (8.314 J/(mol·K))

T is the temperature in Kelvin

K is the equilibrium constant

Given the free-energy change for the reaction is 77.12 kJ/mol, we need to convert it to joules and Kelvin:

ΔG = 77.12 kJ/mol × 1000 J/kJ

= 77120 J/mol

T = 25°C + 273.15 K = 298.15 K

Now, we can calculate the equilibrium constant (K):

K = [tex]e^{(-ΔG/RT)}[/tex]

K =[tex]e^{(-77120J/mol}[/tex] / (8.314 J/(mol·K) × 298.15 K))

K ≈ [tex]e^{(-31.024)}[/tex]

K ≈ 9.74

Therefore, the equilibrium constant (K) is approximately 9.74 (rounded to two significant figures).

To know more about equilibrium constant here

https://brainly.com/question/30620209

#SPJ4

path of an electron from a molecule of water to the sugar g3p

Answers

The path of an electron from a molecule of water to the sugar G3P involves the electron transport chain (ETC) process. This is a series of protein complexes that transfer electrons from electron donors to electron acceptors through redox reactions, ultimately producing ATP and water.

In photosynthesis, light energy is harnessed and used to produce energy-rich compounds, such as glucose, from CO2 and H2O. The first step of photosynthesis involves the absorption of light energy by pigment molecules, which excites an electron that is transferred to an electron acceptor.The electron then passes through the ETC, which is made up of protein complexes, and eventually reaches photosystem I (PSI), where it is excited again by another photon of light. This electron is then passed onto NADP+ to form NADPH, which is used in the Calvin cycle to produce G3P. Water is also split in this process, releasing oxygen as a byproduct, and providing the electron needed for PSI to generate NADPH.Overall, the path of an electron from a molecule of water to the sugar G3P involves the transfer of electrons through the ETC, which is fueled by light energy absorbed during photosynthesis.

To know more about protein complexes visit:

https://brainly.com/question/3167745

#SPJ11

Other Questions
y=5xy=-3x+24Solve by substitution What is the value of Point C on the number line below?A) 0.208B) 0.28C) 0.302D) 0.32 If riding a lawnmower engine exerts 19 hp in one minute to move the lawnmower how much work is done in a classroom for gifted students, we would expect the distribution of iq scores to be: Which choice identifies the compound's structural formula, and what information does the structural formula providethat the molecular formula does not?Image B represents the structural formula, and only the structural formula allows the molecularshape to be determined because it shows the position and alignment of the atoms and bonds.Image B represents the structural formula, and only the structural formula allows the number ofatoms of each element in the compound to be determined because it provides subscripts.Image A represents the structural formula, and only the structural formula allows the type ofbond formed by the compound to be determined because it shows the element symbols writtenin order (metals and then nonmetals).Image A represents the structural formula, and only the structural formula allows the bondlength of each bond between the atoms of the compound to be determined because it shows thebonds represented by a line. let f be a function with derivative given by f x ( ) = 3 x + 1. what is the length of the graph of y f = ( )x from x = 0 to x = 1.5 ? A forest has many trees and bushes that produce nuts. This is a major food sources for many species, including a particular bird. Birds of this species have a variety of beak shapes ranging from long and pointy to short and hard beaks. The birds with short and hard beaks are able to eat the nuts better than the birds with long and pointy beaks. According to this scenario and the principles of natural selection what will happen to this bird population over time. Group of answer choices PLEASE HELP !!!! find the focus (parabolas)(y-2)^2=4(x+3) Sally drives from Turlock to Los Angeles at anaverage speed of 60 miles per hour. Turlock isapproximately 300 miles from Los Angeles. Whichof the following graphs could give Sallysapproximate distance d, in miles from Los Angeles,in terms of time t, in hours? A, B, C, D, or E? 4. A bacterial cell is prokaryotic, while the protist, Euglena, is eukaryotic. Which structure is presentin both organisms?*(10 Points) The revising stage of the editing process includes:A. drafting.B. editing, feedback, and making final changes.C. brainstorming and outlining.D. verbs. sorry for only 13 points. I will give brainiest though!! plz answer asap QUESTION 23 Meacham Enterprises bonds currently sell for $1,100 and have a par value of $1,000. They pay a $100 annual coupon and have a 15-year maturity, but they can be called in 5 years at $1,075. Money that must be paid for the use of factors of production such as labor and capital is an:A) accounting profit.B) implicit cost.C) economic profit.D) explicit cost. HELP PLEASE I NEED HELP ! 40 POINTS !! 40 POINTS !!PLEASE HELP , DONT SKIP !NO LINKS OR FILES. On December 31, Russell Company had 123,000 shares of $30 par value common stock issued and outstanding. On this date, they split the stock 5:1. Required: 1. How many shares of common stock will be outstanding after the stock split? 2. What is the new par value of each share of common stock after the stock split? Number of shares outstanding 0 Par value of each share Worth five points! it doesnt tell me if what answer is right but if i get 75% or up i will mark the first person who answered with an actual answer brainliest and i don't lie about brainliest!! Please no nonsense answers I just want help :(Triangle DEF is an isosceles triangle with DE = EF, and mE =92What is mD?A. 45B. 44C. 88D. 90 porque los alimentos se oscurecen?(platanos, palta, manzana, papa, etc) respondan pls (-10) + 3 = 10 - 3 is true or false???