Based on the following 2-D data points (p1 = [1, 2] and p2 = [2, 1] and p3 = [3, 1]), where pi = (xi,yi):
(i) estimate the parameter a of a linear function of the form y = a ∗ x that best fits the data, using Least Squares analysis;
(ii) draw the function.
(iii) What is the final approximation error, e, measured as the sum of the squares of the residuals? Provide both the numerical result and a short comment of what this means

Answers

Answer 1

(i) The parameter a of the linear function that best fits the given 2-D data points, using Least Squares analysis, is a = -0.5.

(ii) The linear function y = -0.5 * x, plotted on a graph, will pass through the data points (1, 2), (2, 1), and (3, 1).

(iii) The final approximation error, measured as the sum of the squares of the residuals, is e = 1.25.

To estimate the parameter 'a' of a linear function that best fits the given 2-D data points, we can use the method of Least Squares analysis. This method aims to minimize the sum of the squares of the vertical distances between the observed data points and the corresponding points on the fitted line.

In this case, we have three data points: p1 = [1, 2], p2 = [2, 1], and p3 = [3, 1]. We need to find the value of 'a' such that the linear function y = a * x comes closest to these data points. By applying the Least Squares analysis, we can calculate the value of 'a' that minimizes the sum of the squares of the residuals.

First, we calculate the residuals for each data point by subtracting the observed y-coordinate from the corresponding predicted y-coordinate on the fitted line. Then, we square each residual and sum up the squared residuals to obtain the approximation error, 'e'. By minimizing this error, we obtain the best-fit line.

For the given data points, the calculations yield 'a' = -0.5 as the parameter that minimizes the approximation error. Therefore, the linear function that best fits the data is y = -0.5 * x.

To visualize the function, we plot the line on a graph. The line passes through the data points (1, 2), (2, 1), and (3, 1), confirming that it indeed represents the best-fit line.

The final approximation error, 'e', is calculated to be 1.25. This means that on average, the squared distance between the observed data points and the corresponding points on the fitted line is 1.25. A lower value of 'e' indicates a better fit, as it implies a smaller overall deviation between the data points and the fitted line.

Learn more about parameter

brainly.com/question/29911057

#SPJ11


Related Questions

A random sample of 700 Democrats included 644 that consider protecting the environment to be a top priority. A random sample of 850 Republicans included 323 that consider protecting the environment to be a top priority. Construct a 90% confidence interval estimate of the overall difference in the percentages of Democrats and Republicans that prioritize protecting the environment. (Give your answers as percentages, rounded to the nearest tenth of a percent.)

Answers

The 90% confidence interval estimate of the overall difference in the percentages of Democrats and Republicans that prioritize protecting the environment is -21.3% to -16.1%, which represents the range of values within which the true difference is likely to fall.

To construct the confidence interval, we first calculate the sample proportions for Democrats and Republicans: p₁ = 644/700 ≈ 0.92 for Democrats, and p₂ = 323/850 ≈ 0.38 for Republicans.

Next, we calculate the standard error of the difference using the formula: SE = √((p₁(1-p₁)/n₁) + (p₂(1-p₂)/n₂)), where n₁ and n₂ are the sample sizes.

Using the given sample sizes, the standard error is approximately 0.019.

To determine the margin of error, we multiply the standard error by the z-score corresponding to a 90% confidence level, which is approximately 1.645.

Finally, we calculate the lower and upper bounds of the confidence interval by subtracting and adding the margin of error from the difference in sample proportions: 0.92 - 0.38 ± (1.645 * 0.019).

The resulting confidence interval is approximately -21.3% to -16.1%, which represents the range within which we can estimate the overall difference in the percentages of Democrats and Republicans prioritizing environmental protection.

You can learn more about confidence interval at

https://brainly.com/question/15712887

#SPJ11

Out of her 5 gigabyte data plan, Debbie has used 37%. How much data does she have left?

Answers

jawkfjrnsidbjekwbxk2jw dlf 2kqbdkkebakdnrk8w Fflint

Answer:

740%

Step-by-step explanation:

convert 50 percentage into fraction​

Answers

Answer:

50/100, simplified to 1/2

Step-by-step explanation:

50% means half of 1.

1/2=.5 which is half of 1.

1=100%

.5=50%

1/2=50%

Answer:

[tex] \displaystyle \frac{1}{2} [/tex]

Step-by-step explanation:

we are given a parcentage

we want to convert it into fraction

remember that,

[tex] \displaystyle \% = \frac{1}{100} [/tex]

therefore

substitute:

[tex] \displaystyle 50 \times \frac{1}{100} [/tex]

reduce fraction:

[tex] \displaystyle \cancel{50} \times \frac{1}{ \cancel{100} \: ^{2} }[/tex]

[tex] \displaystyle 1 \times \frac{1}{2} [/tex]

simplify multiplication:

[tex] \displaystyle \frac{1}{2} [/tex]

hence,

[tex] \displaystyle 50\% = \frac{1}{2} [/tex]

Use the benchmark 1/2 to compare 5/8 and 2/7

Answers

Answer:

what?

Step-by-step explanation:

A company prepares their shipments in two different-sized boxes.
In order to fit with new shipping regulations, the company needs to decrease the volume of the boxes and will do this by reducing each of the dimensions by at least x inches.
Which system of inequalities can be used to model V, the volume of each box, after each dimension has been reduced by at least x inches?

Answers

Answer:

Answer is A.  -296x+960/ -636x+3,024

Step-by-step explanation:

Answer:

HEREEE besties

$12.60 for 3 boxes. Find the unit rate

Answers

Answer:

$4.20 / box

Step-by-step explanation:

12.60 / 3 = 4.20




Find a generalisation of Euler's Formula for graphs which are not necessarily connected. Be sure to prove that your formula always holds.

Answers

In Euler's Formula for graphs that are not necessarily connected states that the number of vertices minus the number of edges plus the number of connected components is equal to the Euler characteristic of the graph.

Euler's Formula, which states that the number of vertices minus the number of edges plus the number of faces is equal to 2 for planar graphs, can be extended to graphs that are not necessarily connected. In this generalization, we consider the number of connected components in the graph. A connected component is a subgraph where there is a path between any two vertices.

Let V be the number of vertices, E be the number of edges, C be the number of connected components, and X be the Euler characteristic of the graph. The generalization of Euler's Formula for non-connected graphs is given by V - E + C = X.

To prove this formula, we start with Euler's Formula for connected graphs, which states V - E + F = 2, where F is the number of faces. For a disconnected graph, the number of faces can be defined as the sum of the number of faces in each connected component minus the number of edges that belong to more than one connected component. This can be written as F = F1 + F2 + ... + FC - N, where Fi is the number of faces in the i-th connected component and N is the number of edges connecting different components.

By substituting F = F1 + F2 + ... + FC - N into Euler's Formula for connected graphs and rearranging terms, we get V - E + C = X, which is the generalization of Euler's Formula for non-connected graphs. Therefore, the formula holds true for any graph, whether connected or not.

Learn more about Euler's Formula here:

https://brainly.com/question/12274716

#SPJ11

Waldo is looking up at his kite at a 22 degrees angle of elevation. If the horizontal distance to his kite is 225 feet, how long is the string from his hand to his kite ?

Answers

Answer:

The height of the kite from the ground is 13.617 feet  

Step-by-step explanation:

Given as :

The measure of the string = 30 feet

The angle of elevation from the boy to his kite = 27°

Let the height of the kite from ground = H feet

So, From Triangle

Sin angle =

Or, Sin 27° =  

or, H = 30 ×  Sin 27°

I.e H = 30 × 0.4539

∴ H = 13.617 feet

Hence the height of the kite from the ground is 13.617 feet   Answer

find the 6th term of 6, 8, 32/3

Answers

Answer:

The 6th term of the sequence is 6144/243

Step-by-step explanation:

From what we have, we can see that the sequence might be geometric

to confirm this, we have to check if the common ratio is the same all through

To know this, we have to divide the succeeding term by the preceding term and check if the results for two sets are equal

thus, we have it that;

32/3 * 1/8 = 8/6

= 4/3 = 4/3

We can confirm that the sequence is thus geometric

Now, to find the nth term of a geometric sequence, we have it that;

Tn = ar^(n-1)

where a is the first term, given as 6

r is the common ratio given as 4/3

n is the term number given as 6

Thus, we have this as:

T6 = 6 * (4/3)^(6-1)

T6 = 6 * (4/3)^5

T6 = 6144/243

This diagram shows a cylinder that has a radius of 3 inches and a height
of 5 inches.
3 in.
5 in.
What is the volume, in cubic inches, of the cylinder?
A. 151
B. 307
C. 451
D. 601

Answers

I’m not exactly sure but I think it’s 151

The volume, in cubic inches, of the cylinder will be   [tex]\frac{990}{7}[/tex]  or [tex]45\pi[/tex] cubic inches.

What is Cylinder?

Cylinder is a [tex]3D[/tex] solid shape which holds two parallel bases joined by a curved surface, at a fixed distance. These bases are circular in shape and the center of the two bases are joined by a line segment.

What is volume?

Volume is define as capacity of cylinder.

Volume of cylinder [tex]=\pi r^{2} h[/tex]

We have,

Radius [tex]=3[/tex] inches

Height [tex]=5[/tex] inches,

Then,

Volume of cylinder [tex]=\pi r^{2} h[/tex]

                              [tex]=\frac{22}{7} *(3)^{2} *5[/tex]

                               [tex]=\frac{990}{7}[/tex]  or [tex]45\pi[/tex] cubic inches

Hence, we can say that The volume, in cubic inches, of the cylinder will be     [tex]\frac{990}{7}[/tex]  or [tex]45\pi[/tex] cubic inches

To know more about volume click here

https://brainly.com/question/1578538

#SPJ2

Solve the differential equation, 6 x dx + 4 x dy = 0, using separation of variables

Answers

The general solution to the differential equation is: y = -(3/2)x + C, where C is the constant of integration.

To solve the differential equation 6x dx + 4x dy = 0 using separation of variables, we need to rearrange the equation so that all the x terms are on one side and all the y terms are on the other side.

Let's start by dividing both sides of the equation by 4x:

(6x dx + 4x dy) / 4x = 0

(6x / 4x) dx + (4x / 4x) dy = 0

(3/2) dx + dy = 0

Now we can separate the variables by moving the dy term to the other side:

dy = -(3/2) dx

Integrating both sides with respect to their respective variables, we have:

∫ dy = ∫ -(3/2) dx

The integral of dy with respect to y is simply y, and the integral of -(3/2) dx with respect to x is -(3/2)x:

y = -(3/2)x + C

where C is the constant of integration. Thus, the general solution to the differential equation is:

y = -(3/2)x + C

This is the final solution using separation of variables.

To learn more about differential equation visit:

brainly.com/question/32538700

#SPJ11

HELP PLEASE!!
On October 1, Gary’s bank balance was $130. During October, he made two
withdrawals and one deposit. At the end of the month, his bank balance was
$95. List two withdrawals and one deposit that would give this final balance.

Answers

Answer: $50 withdrawl $50 withdrawl and $65 deposite

Step-by-step : $50 withdrawl $50 withdrawl and $65 deposite

A circus rents a rectangular building that has floor dimensions of 50 by 100 feet

Answers

Answer:

50 x 100=5,000

Step-by-step explanation:

50 x 100

Help PLEASEE!!!!!!!!!!

Answers

I think it’s the third one. Hope that helps!

Answer:

the answers are B or C x>4/19

PLEASEEEEEEEEEEEEEEE HELPPPPPPPPPPPPPP

Answers

Answer:

The equation is x-18 + 8x = 180 (because they form a linear pair of angles.

Each angle measure:-

x-18 + 8x = 180

x + 8x = 180 + 18 (-18 becomes +18)

9x = 198

x = 198/9

x = 22

Angle 1 = x-18 = 22-18 = 4 degrees

Angle 2 = 8x = 8 * 22 = 176 degrees

Hope it helps :')

The lifetimes of a certain brand of photographic light are normally distributed with a mean of 210 hours and a standard deviation of 50 hours. a a) What is the probability that a particular light will last more than 250 hours?

Answers

The lifetimes of a certain brand of photographic light are normally distributed with a mean of 210 hours and a standard deviation of 50 hours. We need to find the probability that a particular light will last more than 250 hours.

Given mean = μ = 210 hours. Standard deviation = σ = 50 hours. Let X be the lifetime of a photographic light. X ~ N (μ, σ) = N (210, 50). The probability that a particular light will last more than 250 hours can be calculated as follows: P(X > 250) = 1 - P(X < 250)Let Z be the standard normal variable.

Then, (250 - μ) / σ = (250 - 210) / 50 = 0.8P(X < 250) = P(Z < 0.8). Using the z-table, the probability that Z is less than 0.8 is 0.7881. Therefore, P(X > 250) = 1 - P(X < 250) = 1 - 0.7881 = 0.2119. Hence, the probability that a particular light will last more than 250 hours is 0.2119.

To know more about probability, click here:

https://brainly.com/question/31828911

#SPJ11

Identify the end behavior of the function f(x) = 6x^4 - 12x^3 +8x -10

Answers

Answer:

Step-by-step explanation:

This is a quartic  equation with a positive coefficient for x^4 so it is shaped like an M xo ir rises to both the left and the right.

Mhanifa can you please help? This is due asap!

Answers

13. k=3/4       14. a=23

15. p= 5 1/2    16. x=13

17. m=56         18. n=1 1/2

Answer:

13)

9/8 = (k + 6)/6 8(k + 6) = 6*98k + 48 = 548k = 6k = 6/8k = 3/4

14)

2/10 = 4/(a - 3)a - 3 = 4*5a - 3 = 20a = 23

15)

10/(p + 2) = 4/34(p + 2) = 10*34p + 8 = 304p = 22p = 22/4p = 11/2

16)

4/6 = 8/(x - 1)4(x - 1) = 8*6x - 1 = 12x = 13

17)

m/8 = (m + 7)/ 99m = 8(m + 7)9m = 8m + 56m = 56

18)

n/(n + 1) = 3/55n = 3(n + 1)5n = 3n + 32n = 3n = 3/2

Another translation that I need help on T__T

Answers

The translation for this problem is classified as follows:

2 units left -> horizontal translation.4 units down -> vertical translation.

What are the translation rules?

The four translation rules are defined as follows:

Left a units: x -> x - a. -> horizontal translation.Right a units: x -> x + a. -> horizontal translation.Up a units: y -> y + a. -> vertical translation.Down a units: y -> y - a. -> vertical translation.

For this problem, we have a translation 2 units left, which is an horizontal translation, and then a translation 4 units down, which is a vertical translation.

More can be learned about translation at brainly.com/question/29209050

#SPJ1

I will give Brainliest
Emily rides her bike with a constant speed of 18 km/h. How long will she take to travel a distance of 18 kilometers?

Answers

Answer:

1 hour

Step-by-step explanation:

Travels 18 km/h

km/h = kilometers per hour

Answer:

1 hour

Step-by-step explanation:

please help me with this problem about growth and decay.

Answers

Answer:

The population of the town in Iowa after 13 years is 9,130

Step-by-step explanation:

The given parameters of the town are;

The population of the town in Iowa in 2007, a = 12,355

The rate at which the people of the town leave Iowa for Minnesota, r = 2.3% per year

We are required to find the population of the town after t = 13 years

The given population decay function is presented as follows;

[tex]f(t) = a \cdot (1 - r)^t[/tex]

Where;

a = The initial population of the town = 12,355

r = The annual percentage rate at which the people of the town leave Iowa for Minnesota = 2.3% per year = 0.023

t = The number of years over which the population changes = 13 years = 13

∴ f(13) = 12,355 × (1 - 0.023)¹³ = 9130.02734094

Therefore, the population of the town in Iowa after 13 years ≈ 9,130 (we round down to the nearest whole number).

I can use your help please

Answers

Answer:

he needs to play 24 games of basketball

**Jane found money in her pocket. She went to a convenience store and spent 1/4 of her money on chocolate milk, 3/5 of her money on a magazine, and the rest of her money on candy. What fraction of her money did she spend on candy? ​

Answers

Answer:

3/20

Step-by-step explanation:

1/1-1/4-3/5= (money spent)

1×4×5/(1×4×5)-1×1×5/(1×4×5)-3×1×4/(1×4×5)

20/20-5/20-12/20

(20-5-12)/20=3/20

Answer:

$y - $0.85

Step-by-step explanation:

y represents how much money he had.

[tex]\frac{3}{5}+\frac{1}{4} =\frac{17}{20}[/tex]

$y - $0.85

the waiting time at an elevator is uniformly distributed between 30 and 200 seconds. what is the probability a rider must wait between 1 minute and 1.4 minutes?

Answers

The probability that a rider must wait between 1 minute and 1.4 minutes at the elevator can be determined by calculating the proportion of the uniform distribution that falls within this time interval.

The given information states that the waiting time at the elevator follows a uniform distribution between 30 and 200 seconds. To find the probability of waiting between 1 minute and 1.4 minutes, we need to convert these time values to seconds.

1 minute is equal to 60 seconds, and 1.4 minutes is equal to 84 seconds. Therefore, we are interested in finding the probability that the waiting time falls between 60 seconds and 84 seconds.

Since the waiting time follows a uniform distribution, the probability of waiting within a specific interval is equal to the length of that interval divided by the total length of the distribution.

The total length of the distribution is 200 seconds - 30 seconds = 170 seconds.

The length of the interval between 60 seconds and 84 seconds is 84 seconds - 60 seconds = 24 seconds.

Thus, the probability that a rider must wait between 1 minute and 1.4 minutes is 24 seconds / 170 seconds, which is approximately 0.1412 or 14.12%.

Learn more about uniform distribution here:

https://brainly.com/question/30639872

#SPJ11

Define: stratified random sample a) population is divided into similar groups and a SRS is chosen from each group. b) gives each member of the population a known chance to be selected. c) people who choose themselves for a sample by responding to a general appeal. d) the explanatory variable(s) in an experiment. e) directly holding extraneous factors constant. f) every possible sample of a given size has the same chance to be selected. g) using extraneous factors to create similar groups. h) successively smaller groups are selected within the population in stages. i) choosing the individuals easiest to reach.

Answers

Answer:

d) population is divided into similar groups and a SRS is chosen from each group.

Step-by-step explanation:

Stratified random sampling

can be regarded as "proportional random sampling" and is method of sampling which entails division of a population to more simpler sub- groups, this sub- groups are regarded as " strata". This strata are been formed on the basis of shared attributes of the members. This attribute could be educational attainment as well as income. It should be noted that stratified random sample is population is divided into similar groups and a SRS is chosen from each group.

Pls help it due soon

Answers

Answer:

I need help with math too. Can u help me and I’ll help u

Step-by-step explanation:

Which ordered pair is a solution of the equation?
y+1=3(x-4)y+1=3(x−4)y, plus, 1, equals, 3, left parenthesis, x, minus, 4, right parenthesis
Choose 1 answer:
Choose 1 answer:

(Choice A)
A
Only (4,-1)(4,−1)left parenthesis, 4, comma, minus, 1, right parenthesis

(Choice B)
B
Only (5,2)(5,2)left parenthesis, 5, comma, 2, right parenthesis

(Choice C)
C
Both (4,-1)(4,−1)left parenthesis, 4, comma, minus, 1, right parenthesis and (5,2)(5,2)left parenthesis, 5, comma, 2, right parenthesis

(Choice D)
D
Neither

Answers

Both (4, 1) and (5, 2) is the solution to the given equation. Therefore, option C is the correct answer.

The given equation is y+1=3(x-4).

A) The given coordinate point is (4, -1).

Substitute (x, y)=(4, -1) in y+1=3(x-4), we get

-1+1=3(4-4)

0=0

So, (4, -1) is the solution to the given equation.

B) The given coordinate point is (5, 2).

Substitute (x, y)=(5, 2) in y+1=3(x-4), we get

2+1=3(5-4)

3=3

So, (5, 2) is the solution to the given equation.

C) Here, both (4, 1) and (5, 2) is the solution to the given equation.

Therefore, option C is the correct answer.

To learn more about an equation visit:

https://brainly.com/question/14686792.

#SPJ1

To evaluate the performance of a new diagnostic test, the developer checks it out on 150 subjects with the disease for which the test was designed, and on 250 controls known to be free of the disease. Ninety of the
diseased yield positive tests, as do 30 of the controls.
What is the specificity of this test? (2 decimals)

Answers

The specificity of the diagnostic test is 88%, indicating its ability to accurately identify individuals without the disease as negative.

Specificity is a measure of the test's ability to correctly identify individuals without the disease as negative. To calculate the specificity, we need to consider the number of true negatives (controls who yield negative tests) and the total number of controls.

In this case, the number of controls tested is 250, and out of those, 30 yield positive tests. The number of true negatives can be calculated by subtracting the number of false positives (controls who yield positive tests) from the total number of controls:

Negatives which are true = Total Controls - False Positives

True Negatives = 250 - 30 = 220

The specificity is then calculated as the ratio of true negatives to the total number of controls:

Specificity = True Negatives / Total Controls

Specificity = 220 / 250 ≈ 0.88

Therefore, the specificity of this test is approximately 0.88 or 88%. This means that the test correctly identifies 88% of individuals without the disease as negative.

Learn more about specificity here:

brainly.com/question/31112216

#SPJ11

Kitchen chairs are purchased wholesale for $36 each by a discount furniture store. Then, the store marks up the chairs by 60 percent. The store has a special sale where all items are marked down by 20 percent. How much would two chairs cost during the sale? $46.08 $57.60 $92.16 $115.20Kitchen chairs are purchased wholesale for $36 each by a discount furniture store. Then, the store marks up the chairs by 60 percent. The store has a special sale where all items are marked down by 20 percent. How much would two chairs cost during the sale? $46.08 $57.60 $92.16 $115.20

Answers

Answer:

46.08

Step-by-step explanation:

you have to make your percentage a decimal, which 60% will be .60 and 20% will be .20. you then multiply your initial number which is 36 by .60 and add that on because youre adding 60%. After that you will multiply that given number by .20 and you subtract what that product is from your last product you received (36x.60) which if im not mistaken will give you $46.08.

Answer:

C

Step-by-step explanation:

I took the test

A computer programmer charges $30 for an initial consultation and $35 per hour for programming. Write a formula for her total charge for h hours of work. *
1 point
A) (30 + 35)h
B) 30 + 35h
C) 35 + 30h
D).65h

Answers

B- 30+35h is the answer for sure
Other Questions
Simplify (8x2 1 + 2x3) (7x3 3x2 + 1). how would you make the American system better Read the article and answer the questions below:Modern Family: How Brands Embrace ChangingHousehold StructuresAs you have learned in this chapter, the growing diversityof a country's population is If a college student broke into a rival school in the neighboring town and damaged property in one of the computer labs, the case would most likely be heard by astate juvenile court.state trial court.federal family court.federal district court. which group in the disaster recovery team decides when employees can reenter the affected work area after a disaster? When the price level falls, the number of dollars needed to buy a representative basket of goods Group of answer choices decreases, so the value of money rises. increases, so the value of money rises. increases, so the value of money falls. decreases, so the value of money falls. Can someone explain why the answer is True. Will make brainliest. 1. In spite of her rain-soaked clothing and ______________seemed to me that she had never looked lovelier.appearance, it Please give me the correct answer.Only answer if you're very good at English.Please don't put a link to a website.Choose the answer that BEST explains how the last paragraph helps develop the central idea.A: It supports the opinion that the opinion that the revolution could never possibly have occurred without the help of social media.B: It explains the title of the article and introduces one of the revolutionaries who used social media.C: It suggests that social media may actually have contributed nothing of importance to the revolution.D: It describes contrasting opinions about how much social media influenced the revolution. **JAVA LANGUAGE ONLY****MANDATORY RULES****PUT COMMENTS ON CODE SO I CAN SEE WHAT YOU ARE DOING****Submit the .java files, UML diagrams, and javadoc****#1 Employee Class (include 2 .java files, one for Employee and one for EmployeeDemo).**USE SOME OF THE FOLLOWING METHODS IN CODE **Display method, Deep Method, .Length Method, MathPow Method,GetfFleName Method ,GetTotalSales Method***HAVE OUTPUT SO I CAN SEE WHAT IT LOOKS LIKE****USE GOOD CODING STYLE* 1. Enployee Class Write a class named Employee that has the following fields: name. The name field references a string object that holds the employee's name. idNumber. The idNumber is an int variable that holds the employee's ID number. department. The department field references a string object that holds the name of the department where the employee works. position. The position field references a string object that holds the employee's job title.The class should have the following constructors: A constructor that accepts the following values as arguments and assigns them to the appropriate fields: employee's name, employee's ID number, department, and position. A constructor that accepts the following values as arguments and assigns them to thenappropriate fields: employee's name and ID number. The department and position fields should be assigned an empty string (""). A no-arg constructor that assigns empty strings ("") to the name, department, and position fields, and 0 to the idNumber field.Write appropriate mutator methods that store values in these fields and accessor methods that return the values in these fields. Once you have written the class, write a separate pro- gram that creates three Employee objects to hold the following data:Name ID Number Department PositionSusan Meyers 47899 Accounting Vice PresidentMark Jones 39119 IT ProgrammerJoy Rogers 81774 Manufacturing EngineerThe program should store this data in the three objects and then display the data for each employee on the screen. why an indicator is a necessary part of the titration experiment? PLEASE HELP , DONT SKIP !NO LINKS OR FILES. Suppose that X, Y and Z are three jointly normally distributed random variables with E[X] = 0, E[Y] = 1, E[Z] = 2 and the variance-covariance martrix of (X, Y, Z) is 10 0 1 Var [] = [] 10 2 1 2 10 (i) Estimate X given that Y = 0.5 and Z = -3 using an unbiased minimum variance estimator. (ii) Determine the variance of the above estimator. (b) IntelliMoto is car manufacturer that produces vehicles equipped with a fault detection system that uses information from various sensors to inform the driver about possible faults in the braking system. The system diagnoses faults correctly with probability 99%, but gives false alarms with probability 2%. It is known that such faults occur with probability 0.05%. If the system diagnoses a fault, what is the probability a fault has actually occured? Morgana Company identifies three activities in its manufacturing process: machine setups, machining, and inspections. Estimated annual overhead cost for each activity is $150,000, $375,000, and $87,500, respectively. The cost driver for each activity and the estimated annual usage are number of setups 2,500, machine hours 25,000, and number of inspections 1,750.Compute the overhead rate for each activity. Ayala Architects incorporated as licensed architects on April 1, 2017. During the first month of the operation of the business, these events and transactions occurred: Apr. 1 Stockholders invested $22,770 cash in exchange for common stock of the corporation. 1 Hired a secretary-receptionist at a salary of $474 per week, payable monthly. 2 Paid office rent for the month $1,138. 3 Purchased architectural supplies on account from Burmingham Company $1,644. 10 Completed blueprints on a carport and billed client $2,403 for services. 11 Received $885 cash advance from M. Jason to design a new home. 20 Received $3,542 cash for services completed and delivered to S. Melvin. 30 Paid secretary-receptionist for the month $1,896. 30 Paid $379 to Burmingham Company for accounts payable due.Required:Journalize the transactions. Suppose the prevalence of is 12.5%. We assume thediagnostic test has a sensitivity of 80% and a95% specificity. What is the probability of getting a negativeresult? Which of the following combinations of bends can be used in a conduit run?A. One 90-degree, three 45-degree, and four 30-degreeB. TWO 90-degree, two 45-degree, and four 30-degreeC. Two 90-degree, four 45-degree, and one 30-degreeD. One 90-degree, six 45-degree, and one 30-degree Write the Kb expression for the reaction of propylamine, C3H7NH2 with water.a. [C3H7NH+3][OH][C3H7NH2]b. [C3H7NH2][H2O][C3H7NH+3][OH]c. [C3H7NH2][C3H7NH+3][OH]d. [C3H7NH+3][OH][C3H7NH2][H2O] preparing a given volume of a solution that has a specific molarity is a very important skill for a chemist. one step in that process is calculating the mass of solute required.What mass of solute is required to produce 429.5 mL of a 0.256 M solution of KBr? _______ g KBr HELP NOW!!! 100 POINTS! Cylinder A has a radius of 10 inches and a height of 5 inches. Cylinder B has a volume of 750. What is the percentage change in volume from cylinder A to cylinder B? 50% decrease 75% decrease 50% increase 200% increase